(-)-2-Norlimacine
AlkaPlorer ID: AK044988
Synonym: '2-Norlimacine', '(-)-2-Demethyllimacine', '(+)-2-Northalrugosine', 'Dihydrotiliafunimine'
IUPAC Name: (1S,14R)-9,20,25-trimethoxy-30-methyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18,20,22(33),24,26,31-dodecaen-21-ol
Structure
SMILES: COC1=CC=C2C=C1OC1=CC=C(C=C1)C[C@H]1C3=C(C=C(OC)C(=C3)OC3=C4C(=CC(OC)=C3O)CCN[C@@H]4C2)CCN1C
InChI: InChI=1S/C36H38N2O6/c1-38-14-12-23-18-30(41-3)32-20-26(23)28(38)16-21-5-8-25(9-6-21)43-31-17-22(7-10-29(31)40-2)15-27-34-24(11-13-37-27)19-33(42-4)35(39)36(34)44-32/h5-10,17-20,27-28,37,39H,11-16H2,1-4H3/t27-,28+/m1/s1
InChIKey: VPIWCSVVIJIYRD-IZLXSDGUSA-N
Reference
Cytotoxic and Antimalarial Bisbenzylisoquinolme Alkaloids from Stephania erecta
PubChem CID: 13890733
LOTUS: LTS0082389
SuperNatural Ⅲ: SN0396517-01
NPASS: NPC82457
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Pycnarrhena ozantha | Pycnarrhena | Menispermaceae | Ranunculales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Stephania erecta | Stephania | Menispermaceae | Ranunculales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 594.7080000000001
TPSA？: 81.65
MolLogP？: 6.517200000000008
Number of H-Donors: 2
Number of H-Acceptors: 8
RingCount: 8
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | A-431 | ED50 | 4.2 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | HT-1080 | ED50 | 2.2 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | KB | ED50 | 6.3 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | KB | ED50 | 10400.0 | nM | 10.1021/np980144f |
| Homo sapiens | LNCaP | ED50 | 6.6 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | SK-MEL-2 | ED50 | 15.4 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | ZR-75-1 | ED50 | 1.2 | ug ml-1 | 10.1021/np50091a005 |
| Mus musculus | P388 | ED50 | 0.1 | ug ml-1 | 10.1021/np50091a005 |
| Plasmodium falciparum | Plasmodium falciparum | ED50 | 68.6 | ng/ml | 10.1021/np50091a005 |
| Plasmodium falciparum | Plasmodium falciparum | ED50 | 125.1 | ng/ml | 10.1021/np50091a005 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 115.0 | nM | 10.1021/np980144f |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 210.0 | nM | 10.1021/np980144f |
| None | ADMET | ED50 | 4.1 | ug ml-1 | 10.1021/np50091a005 |
| None | ADMET | ED50 | 4.7 | ug ml-1 | 10.1021/np50091a005 |
| None | ADMET | ED50 | 8.1 | ug ml-1 | 10.1021/np50091a005 |
| None | ADMET | ED50 | 8.4 | ug ml-1 | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 1.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 2.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 13.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 18.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 23.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 32.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 33.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 34.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 38.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 50.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 53.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 60.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 61.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 65.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 67.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 69.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 92.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 97.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 118.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 123.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 225.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Selectivity Index | 50.0 | None | 10.1021/np980144f |
| None | Unchecked | Selectivity Index | 92.0 | None | 10.1021/np980144f |