Thalrugosidine
AlkaPlorer ID: AK046813
Synonym: None
IUPAC Name: (3S,22S)-10,11,16,27-tetramethoxy-4,21-dimethyl-13,29-dioxa-4,21-diazaheptacyclo[28.2.2.114,18.124,28.03,8.07,12.022,36]hexatriaconta-1(33),7(12),8,10,14(36),15,17,24(35),25,27,30(34),31-dodecaen-15-ol
Structure
SMILES: COC1=CC=C2C=C1OC1=CC=C(C=C1)C[C@H]1C3=CC(OC)=C(OC)C(=C3CCN1C)OC1=C3C(=CC(OC)=C1O)CCN(C)[C@H]3C2
InChI: InChI=1S/C38H42N2O7/c1-39-16-14-26-27-21-33(44-5)37(45-6)36(26)47-38-34-24(20-32(43-4)35(38)41)13-15-40(2)29(34)18-23-9-12-30(42-3)31(19-23)46-25-10-7-22(8-11-25)17-28(27)39/h7-12,19-21,28-29,41H,13-18H2,1-6H3/t28-,29-/m0/s1
InChIKey: NVIHKJYGMWNYEP-VMPREFPWSA-N
Reference
Chemosystematics of Thalictrum minus Complex
PubChem CID: 5321920
LOTUS: LTS0058710
SuperNatural Ⅲ: SN0256259-01
NPASS: NPC229373
Source
Properties Information
Molecule Weight: 638.7610000000002
TPSA?: 82.09
MolLogP?: 6.868000000000009
Number of H-Donors: 1
Number of H-Acceptors: 9
RingCount: 8
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus fumigatus | Aspergillus fumigatus | Activity | nan | None | 10.1021/np50021a003 |
| Candida albicans | Candida albicans | Activity | nan | None | 10.1021/np50021a003 |
| Cryptococcus neoformans | Cryptococcus neoformans | Activity | nan | None | 10.1021/np50021a003 |
| Enterococcus faecalis | Enterococcus faecalis | Activity | nan | None | 10.1021/np50021a003 |
| Escherichia coli | Escherichia coli | Activity | nan | None | 10.1021/np50021a003 |
| Homo sapiens | HT-29 | IC50 | 3600.0 | nM | 10.1021/np501028u |
| Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | nan | None | 10.1021/np50021a003 |
| Leishmania donovani | Leishmania donovani | IC50 | 1000.0 | nM | 10.1021/np501028u |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | nan | None | 10.1021/np50021a003 |
| Sporothrix schenckii | Sporothrix schenckii | Activity | nan | None | 10.1021/np50021a003 |
| Staphylococcus aureus | Staphylococcus aureus | Activity | nan | None | 10.1021/np50021a003 |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | Activity | nan | None | 10.1021/np50021a003 |
| None | Unchecked | Ratio IC50 | 3.6 | None | 10.1021/np501028u |
