Axinelline A
AlkaPlorer ID: AK049487
Synonym: None
IUPAC Name: ethyl (2S)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoate
Structure
SMILES: CCOC(=O)[C@H](CO)N=C(O)C1=CC=CC(O)=C1O
InChI: InChI=1S/C12H15NO6/c1-2-19-12(18)8(6-14)13-11(17)7-4-3-5-9(15)10(7)16/h3-5,8,14-16H,2,6H2,1H3,(H,13,17)/t8-/m0/s1
InChIKey: ZNAULGVROLOSBS-QMMMGPOBSA-N
Reference
Axinelline A, a new COX-2 inhibitor from<i>Streptomyces axinellae</i>SCSIO02208
PubChem CID: 139588023
LOTUS: LTS0193343
{NPAtlas: NPA017693
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Streptomyces axinellae | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 269.253
TPSA？: 119.58
MolLogP？: 0.3263999999999996
Number of H-Donors: 4
Number of H-Acceptors: 6
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | Cyclooxygenase-2 | IC50 | 2220.0 | nM | 10.1021/acs.jnatprod.2c01153 |
| Homo sapiens | L02 | Activity | nan | None | 10.1021/acs.jnatprod.2c01153 |
| Mus musculus | Cyclooxygenase-2 | Inhibition | nan | % | 10.1021/acs.jnatprod.2c01153 |
| Mus musculus | L929 | Activity | nan | None | 10.1021/acs.jnatprod.2c01153 |
| Mus musculus | NF-kappa-B inhibitor alpha | Inhibition | nan | % | 10.1021/acs.jnatprod.2c01153 |
| Mus musculus | RAW264.7 | Activity | nan | None | 10.1021/acs.jnatprod.2c01153 |
| Ovis aries | Cyclooxygenase-1 | IC50 | 8890.0 | nM | 10.1021/acs.jnatprod.2c01153 |
| Ovis aries | Cyclooxygenase-2 | IC50 | 2800.0 | nM | 10.1021/acs.jnatprod.2c01153 |
| Ovis aries | Cyclooxygenase-2 | IC50 | 2800000.0 | nM | 10.1016/j.ejmech.2019.06.034 |
| None | Unchecked | Activity | nan | None | 10.1021/acs.jnatprod.2c01153 |
| None | Unchecked | Inhibition | nan | % | 10.1021/acs.jnatprod.2c01153 |
| None | Unchecked | Ratio IC50 | 4.0 | None | 10.1021/acs.jnatprod.2c01153 |