Hookerianamide J
AlkaPlorer ID: AK051803
Synonym: None
IUPAC Name: N-[(3S,4R,5R,8R,9S,10R,13S,14S)-17-[(1S)-1-(dimethylamino)ethyl]-4-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-methylbut-2-enamide
Structure
SMILES: CC(C)=CC(=O)N[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C([C@H](C)N(C)C)=CC[C@@H]32)[C@H]1O
InChI: InChI=1S/C28H46N2O2/c1-17(2)16-25(31)29-24-13-15-28(5)22-12-14-27(4)20(18(3)30(6)7)10-11-21(27)19(22)8-9-23(28)26(24)32/h10,16,18-19,21-24,26,32H,8-9,11-15H2,1-7H3,(H,29,31)/t18-,19-,21-,22-,23-,24-,26+,27+,28+/m0/s1
InChIKey: UBWMSSICUOCSHT-BJHCZKLTSA-N
Reference
Bioactive 5α-Pregnane-Type Steroidal Alkaloids from <i>Sarcococca hookeriana</i>
PubChem CID: 25016666
LOTUS: LTS0007946
SuperNatural Ⅲ: SN0366248-01
NPASS: NPC55462
Source
Properties Information
Molecule Weight: 442.6880000000002
TPSA?: 52.57000000000001
MolLogP?: 4.937300000000006
Number of H-Donors: 2
Number of H-Acceptors: 3
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | IZ | 15.0 | mm | 10.1021/np800305b |
| Bacillus subtilis | Bacillus subtilis | MIC | 141400.0 | nM | 10.1021/np800305b |
| Enterococcus faecalis | Enterococcus faecalis | Activity | nan | None | 10.1021/np800305b |
| Homo sapiens | Acetylcholinesterase | IC50 | 48500.0 | nM | 10.1021/np800305b |
| Homo sapiens | Butyrylcholinesterase | IC50 | 800.0 | nM | 10.1021/np800305b |
| Leishmania major | Leishmania major | IC50 | 11300.0 | nM | 10.1021/np800305b |
| Micrococcus luteus | Micrococcus luteus | Activity | nan | None | 10.1021/np800305b |
| Micrococcus luteus | Micrococcus luteus | MIC | nan | None | 10.1021/np800305b |
| Pseudomonas | Pseudomonas | IZ | 12.0 | mm | 10.1021/np800305b |
| Pseudomonas | Pseudomonas | MIC | 70700.0 | nM | 10.1021/np800305b |
