Gageostatin A
AlkaPlorer ID: AK053851
Synonym: None
IUPAC Name: (2S)-2-[[(2S)-2-[[(2S)-3-carboxy-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-4-carboxy-2-[[(3R)-3-hydroxy-11-methyltridecanoyl]amino]butanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid
Structure
SMILES: CCC(C)CCCCCCC[C@@H](O)CC(O)=N[C@@H](CCC(=O)O)C(O)=N[C@@H](CC(C)C)C(O)=N[C@@H](CC(C)C)C(O)=N[C@@H](C(O)=N[C@@H](CC(=O)O)C(O)=N[C@@H](CC(C)C)C(O)=N[C@@H](CC(C)C)C(=O)O)C(C)C
InChI: InChI=1S/C52H93N7O14/c1-13-34(12)19-17-15-14-16-18-20-35(60)27-42(61)53-36(21-22-43(62)63)46(66)54-37(23-29(2)3)47(67)56-39(25-31(6)7)50(70)59-45(33(10)11)51(71)57-40(28-44(64)65)49(69)55-38(24-30(4)5)48(68)58-41(52(72)73)26-32(8)9/h29-41,45,60H,13-28H2,1-12H3,(H,53,61)(H,54,66)(H,55,69)(H,56,67)(H,57,71)(H,58,68)(H,59,70)(H,62,63)(H,64,65)(H,72,73)/t34?,35-,36+,37+,38+,39+,40+,41+,45-/m1/s1
InChIKey: ASKJUGVPESKJDD-YNEMRZIYSA-N
Reference
Gageostatins A–C, Antimicrobial Linear Lipopeptides from a Marine Bacillus subtilis
PubChem CID: 139585758
LOTUS: LTS0055319
NPASS: NPC480540
{NPAtlas: NPA009608
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Bacillus | Bacillidae | Phasmatodea | Insecta | Arthropoda | Metazoa | Eukaryota |
| Bacillus subtilis | Bacillus | Bacillaceae | Bacillales | Bacilli | Bacillota | None | Bacteria |
Properties Information
Molecule Weight: 1040.351
TPSA？: 360.26000000000005
MolLogP？: 10.0544
Number of H-Donors: 11
Number of H-Acceptors: 11
RingCount: 0
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | MIC | 16.0 | ug.mL-1 | 10.1021/acs.jnatprod.6b00235 |
| Botrytis cinerea | Botrytis cinerea | MIC | 4.0 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |
| Botrytis cinerea | Botrytis cinerea | MIC | 4.0 | ug.mL-1 | 10.1021/acs.jnatprod.9b00110 |
| Colletotrichum acutatum | Colletotrichum acutatum | MIC | 4.0 | ug.mL-1 | 10.1021/acs.jnatprod.9b00110 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 16.0 | ug.mL-1 | 10.1021/acs.jnatprod.6b00235 |
| Rhizoctonia solani | Rhizoctonia solani | MIC | 4.0 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |
| Rhizoctonia solani | Rhizoctonia solani | MIC | 4.0 | ug.mL-1 | 10.1021/acs.jnatprod.9b00110 |
| Salmonella enterica subsp. enterica serovar Typhi | Salmonella typhi | MIC | 16.0 | ug.mL-1 | 10.1021/acs.jnatprod.6b00235 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 16.0 | ug.mL-1 | 10.1021/acs.jnatprod.6b00235 |