2-Amino-4,6-dihydroxypteridine
AlkaPlorer ID: AK054087
Synonym: 2-Amino-1,5-dihydro-4,6-pteridinedione, Xanthopterin, Uropterin
IUPAC Name: 2-amino-3,5-dihydropteridine-4,6-dione
Structure
SMILES: NC1=NC(O)=C2NC(=O)C=NC2=N1
InChI: InChI=1S/C6H5N5O2/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4/h1H,(H,9,12)(H3,7,8,10,11,13)
InChIKey: VURKRJGMSKJIQX-UHFFFAOYSA-N
Reference
Butterfly wing antineoplastic agents
PubChem CID: 135403800
CAS: 119-44-8
LOTUS: LTS0130288
NPASS: NPC148178
COCONUT: CNP0184800
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Appias nero | Appias | Pieridae | Lepidoptera | Insecta | Arthropoda | Metazoa | Eukaryota |
| Carassius auratus | Carassius | Cyprinidae | Cypriniformes | Actinopteri | Chordata | Metazoa | Eukaryota |
| Gonepteryx rhamni | Gonepteryx | Pieridae | Lepidoptera | Insecta | Arthropoda | Metazoa | Eukaryota |
| None | Colias | Pieridae | Lepidoptera | Insecta | Arthropoda | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 179.13899999999998
TPSA？: 117.78
MolLogP？: -0.9991000000000004
Number of H-Donors: 3
Number of H-Acceptors: 6
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Potency | 28183.8 | nM | None |
| Homo sapiens | Aldehyde dehydrogenase 1A1 | Potency | 28183.8 | nM | None |
| Homo sapiens | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Potency | 25118.9 | nM | None |
| Homo sapiens | Lysine-specific demethylase 4D-like | Potency | 3548.1 | nM | None |
| Homo sapiens | Menin/Histone-lysine N-methyltransferase MLL | Potency | 17782.8 | nM | None |
| Homo sapiens | Microtubule-associated protein tau | Potency | 3981.1 | nM | None |
| Homo sapiens | Solute carrier organic anion transporter family member 1B1 | Inhibition | 104.4 | % | 10.1124/mol.112.084152 |
| Homo sapiens | Solute carrier organic anion transporter family member 1B3 | Inhibition | 104.74 | % | 10.1124/mol.112.084152 |
| Homo sapiens | Thyroid hormone receptor beta-1 | Potency | 35.5 | nM | None |
| Homo sapiens | Tyrosyl-DNA phosphodiesterase 1 | Potency | 14581.0 | nM | None |