Daruisoline
AlkaPlorer ID: AK058528
Synonym: None
IUPAC Name: (1R)-1-[[3-[4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-4-hydroxyphenyl]methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol
Structure
SMILES: COC1=CC2=C(C=C1O)[C@@H](CC1=CC=C(O)C(OC3=CC=C(C[C@@H]4C5=CC(OC)=C(OC)C=C5CCN4C)C=C3)=C1)N(C)CC2
InChI: InChI=1S/C37H42N2O6/c1-38-15-13-26-20-36(43-4)37(44-5)22-29(26)30(38)16-23-6-9-27(10-7-23)45-35-18-24(8-11-32(35)40)17-31-28-21-33(41)34(42-3)19-25(28)12-14-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1
InChIKey: BURJAQFYNVMZDV-FIRIVFDPSA-N
Reference
PubChem CID: 51106
CAS: 70553-76-3
LOTUS: LTS0040579
SuperNatural Ⅲ: SN0035947-03
NPASS: NPC240841
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Gentiana olgae | Gentiana | Gentianaceae | Gentianales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 610.7510000000002
TPSA?: 83.86
MolLogP?: 6.459300000000008
Number of H-Donors: 2
Number of H-Acceptors: 8
RingCount: 6
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Canis lupus familiaris | Canis familiaris | Cmax | 1700.0 | nM | 10.1021/np300232b |
| Cavia porcellus | Potassium voltage-gated channel subfamily E member 1 | Inhibition | 50.0 | % | 10.1021/np300232b |
| Homo sapiens | A673 | GI50 | 9200.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | A673 | LC50 | 19000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | A673 | TGI | 13000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC1806 | GI50 | 17000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC1806 | LC50 | 41000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC1806 | TGI | 27000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC1937 | GI50 | 6900.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC1937 | LC50 | 18000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC1937 | TGI | 11000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC70 | GI50 | 8800.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC70 | LC50 | 19000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HCC70 | TGI | 13000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | HEK293 | Activity | nan | None | 10.1021/np300232b |
| Homo sapiens | HERG | IC50 | 9100.0 | nM | 10.1021/np300232b |
| Homo sapiens | HERG | IC50 | 9600.0 | nM | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 16.7 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 31.1 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 32.2 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 41.6 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 55.1 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 62.1 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 74.8 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Imax | 81.2 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Inhibition | 18.5 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Inhibition | 20.0 | % | 10.1021/np300232b |
| Homo sapiens | HERG | Inhibition | nan | % | 10.1021/np300232b |
| Homo sapiens | HERG | TIME | 6.333e-06 | hr | 10.1021/np300232b |
| Homo sapiens | HERG | TIME | 7.722e-05 | hr | 10.1021/np300232b |
| Homo sapiens | HERG | V1/2 | -64.6 | mV | 10.1021/np300232b |
| Homo sapiens | HERG | V1/2 | -2.6 | mV | 10.1021/np300232b |
| Homo sapiens | MDA-MB-231 | GI50 | 13000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | MDA-MB-231 | LC50 | 30000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | MDA-MB-231 | TGI | 19000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | MDA-MB-453 | GI50 | 9000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | MDA-MB-453 | LC50 | 21000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | MDA-MB-453 | TGI | 14000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | SJRH30 | GI50 | 3700.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | SJRH30 | LC50 | 9700.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Homo sapiens | SJRH30 | TGI | 6000.0 | nM | 10.1021/acs.jnatprod.0c00946 |
| Oryctolagus cuniculus | Oryctolagus cuniculus | Cmax | 1700.0 | nM | 10.1021/np300232b |
| Oryctolagus cuniculus | Potassium voltage-gated channel subfamily E member 1 | IC50 | 52500.0 | nM | 10.1021/np300232b |
| Oryctolagus cuniculus | Potassium voltage-gated channel subfamily H member 2 | Inhibition | 50.0 | % | 10.1021/np300232b |
| None | ADMET | IC50 | 19900.0 | nM | 10.1021/np300232b |
| None | ADMET | Inhibition | 39.0 | % | 10.1021/np300232b |
