Xenortide A
AlkaPlorer ID: AK059123
Synonym: None
IUPAC Name: (2S)-N,4-dimethyl-2-(methylamino)-N-[(2S)-1-oxo-3-phenyl-1-(2-phenylethylamino)propan-2-yl]pentanamide
Structure
SMILES: CN[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC1=CC=CC=C1)C(=O)NCCC1=CC=CC=C1
InChI: InChI=1S/C25H35N3O2/c1-19(2)17-22(26-3)25(30)28(4)23(18-21-13-9-6-10-14-21)24(29)27-16-15-20-11-7-5-8-12-20/h5-14,19,22-23,26H,15-18H2,1-4H3,(H,27,29)/t22-,23-/m0/s1
InChIKey: UAFFXYUNGBKFSK-GOTSBHOMSA-N
Reference
Xenortide Biosynthesis by Entomopathogenic <i>Xenorhabdus nematophila</i>
PubChem CID: 24900168
LOTUS: LTS0267870
SuperNatural Ⅲ: SN0364900-01
NPASS: NPC71684
{NPAtlas: NPA010726
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Xenorhabdus nematophila | Xenorhabdus | Morganellaceae | Enterobacterales | Gammaproteobacteria | Pseudomonadota | None | Bacteria |
| None | Xenorhabdus | Morganellaceae | Enterobacterales | Gammaproteobacteria | Pseudomonadota | None | Bacteria |
Properties Information
Molecule Weight: 409.5740000000002
TPSA？: 61.440000000000005
MolLogP？: 3.049100000000001
Number of H-Donors: 2
Number of H-Acceptors: 3
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Artemia salina | Artemia salina | IC50 | 200.0 | ug.mL-1 | 10.1021/np800053n |
| Bacillus subtilis | Bacillus subtilis | Activity | nan | None | 10.1021/np800053n |
| Erwinia amylovora | Erwinia amylovora | Activity | nan | None | 10.1021/np800053n |
| Escherichia coli | Escherichia coli | Activity | nan | None | 10.1021/np800053n |
| Leishmania donovani | Leishmania donovani | IC50 | 124500.0 | nM | 10.1021/np500390b |
| Mammaliicoccus lentus | Mammaliicoccus lentus | Activity | nan | None | 10.1021/np800053n |
| Nakaseomyces glabratus | Nakaseomyces glabratus | Activity | nan | None | 10.1021/np800053n |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 19200.0 | nM | 10.1021/np500390b |
| Pseudomonas fluorescens | Pseudomonas fluorescens | Activity | nan | None | 10.1021/np800053n |
| Pseudomonas syringae | Pseudomonas syringae | Activity | nan | None | 10.1021/np800053n |
| Ralstonia solanacearum | Ralstonia solanacearum | Activity | nan | None | 10.1021/np800053n |
| Rattus norvegicus | L6 | IC50 | 115500.0 | nM | 10.1021/np500390b |
| Trypanosoma brucei rhodesiense | Trypanosoma brucei rhodesiense | IC50 | 22500.0 | nM | 10.1021/np500390b |
| Trypanosoma cruzi | Trypanosoma cruzi | IC50 | 46400.0 | nM | 10.1021/np500390b |
| Xanthomonas campestris | Xanthomonas campestris | Activity | nan | None | 10.1021/np800053n |