Nagelamide E
AlkaPlorer ID: AK063576
Synonym: '', '(-)-Nagelamide E', 'Ageliferin'
IUPAC Name: N-[[(5S,6R,7R)-2-amino-7-(2-amino-1H-imidazol-5-yl)-6-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]methyl]-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methyl]-4-bromo-1H-pyrrole-2-carboxamide
Structure
SMILES: N=C1NC=C([C@@H]2C3=C(C[C@H](CNC(=O)C4=CC(Br)=CN4)[C@H]2CNC(=O)C2=CC(Br)=CN2)NC(=N)N3)N1
InChI: InChI=1S/C22H24Br2N10O2/c23-10-2-14(27-5-10)19(35)29-4-9-1-13-18(34-22(26)32-13)17(16-8-31-21(25)33-16)12(9)7-30-20(36)15-3-11(24)6-28-15/h2-3,5-6,8-9,12,17,27-28H,1,4,7H2,(H,29,35)(H,30,36)(H3,25,31,33)(H3,26,32,34)/t9-,12-,17-/m1/s1
InChIKey: DMMLTRAQSJWUHT-OGTWGDGJSA-N
Reference
Ageliferins, potent actomyosin Atpase activators from the Okinawan marine sponge sp
PubChem CID: 11169518
CAS: 117417-64-8
LOTUS: LTS0170218
NPASS: NPC115562
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Agelas nakamurai | Agelas | Agelasidae | Agelasida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 620.3100000000001
TPSA?: 200.64
MolLogP?: 1.91954
Number of H-Donors: 10
Number of H-Acceptors: 4
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Acinetobacter baumannii | Acinetobacter baumannii | MIC | 100000.0 | nM | 10.1021/acs.jnatprod.2c00094 |
| Enterococcus faecalis | Enterococcus faecalis | MIC | 100000.0 | nM | 10.1021/acs.jnatprod.2c00094 |
| Escherichia coli | Escherichia coli | MIC | 100000.0 | nM | 10.1021/acs.jnatprod.2c00094 |
| Homo sapiens | OVCAR-3 | Activity | nan | None | 10.1021/acs.jnatprod.2c00094 |
| Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | 100000.0 | nM | 10.1021/acs.jnatprod.2c00094 |
| Mus musculus | L5178Y | Activity | 50.0 | % | 10.1021/acs.jnatprod.2c00094 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 50000.0 | nM | 10.1021/acs.jnatprod.2c00094 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 100000.0 | nM | 10.1021/acs.jnatprod.2c00094 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 100000.0 | nM | 10.1021/acs.jnatprod.2c00094 |
| None | Erythrocyte | Activity | 2.3 | % | 10.1021/acs.jnatprod.2c00094 |
