Epicoccin A
AlkaPlorer ID: AK065768
Synonym: None
IUPAC Name: (1R,4S,5R,6R,9R,11R,14S,15R,16R,19R)-5,15-dihydroxy-21,22,23-trithia-3,13-diazaheptacyclo[14.4.2.16,11.01,13.03,11.04,9.014,19]tricosane-2,8,12,18-tetrone
Structure
SMILES: O=C1C[C@H]2SS[C@@]34C[C@@H]1[C@@H]([C@H]2O)N3C(=O)[C@@]12C[C@H]3C(=O)C[C@@H](S1)[C@H](O)[C@H]3N2C4=O
InChI: InChI=1S/C18H18N2O6S3/c21-7-1-9-13(23)11-5(7)3-17(27-9)15(25)20-12-6-4-18(20,16(26)19(11)17)29-28-10(14(12)24)2-8(6)22/h5-6,9-14,23-24H,1-4H2/t5-,6-,9+,10+,11-,12-,13-,14-,17+,18+/m0/s1
InChIKey: VZUJNQMBOQHGKN-DXOBHMFTSA-N
Reference
Epicoccins A–D, Epipolythiodioxopiperazines from a Cordyceps-Colonizing Isolate of Epicoccum nigrum
PubChem CID: 23642606
LOTUS: LTS0232998
SuperNatural Ⅲ: SN0404516-01
NPASS: NPC220396
{NPAtlas: NPA011420
Source
Properties Information
Molecule Weight: 454.5510000000002
TPSA?: 115.22
MolLogP?: -0.6268000000000002
Number of H-Donors: 2
Number of H-Acceptors: 9
RingCount: 7
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus fumigatus | Aspergillus fumigatus | Activity | nan | None | 10.1021/np070239u |
| Bacillus subtilis | Bacillus subtilis | IZ | 12.0 | mm | 10.1021/np070239u |
| Candida albicans | Candida albicans | Activity | nan | None | 10.1021/np070239u |
| Enterococcus faecalis | Enterococcus faecalis | Activity | nan | None | 10.1021/np070239u |
| Geotrichum candidum | Geotrichum candidum | Activity | nan | None | 10.1021/np070239u |
| Homo sapiens | A2780 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | A549 | Activity | nan | None | 10.1021/np400802d |
| Homo sapiens | A549 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | Bel-7402 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | BGC-823 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | HCT-116 | Activity | nan | None | 10.1021/np400802d |
| Homo sapiens | HCT-116 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | HCT-8 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | HL-60 | Activity | nan | None | 10.1021/np400802d |
| Homo sapiens | K562 | Activity | nan | None | 10.1021/np400802d |
| Homo sapiens | MGC-803 | Activity | nan | None | 10.1021/np400802d |
| Micrococcus luteus | Micrococcus luteus | Activity | nan | None | 10.1021/np070239u |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 100.0 | ug.mL-1 | 10.1016/j.ejmech.2014.10.026 |
| Staphylococcus aureus | Staphylococcus aureus | Activity | nan | None | 10.1021/np070239u |
| Streptococcus mutans | Streptococcus mutans | Activity | nan | None | 10.1021/np070239u |
