Sorazinone B
AlkaPlorer ID: AK076695
Synonym: None
IUPAC Name: 3,6-dibenzyl-5-methyl-1H-pyrazin-2-one
Structure
SMILES: CC1=C(CC2=CC=CC=C2)NC(=O)C(CC2=CC=CC=C2)=N1
InChI: InChI=1S/C19H18N2O/c1-14-17(12-15-8-4-2-5-9-15)21-19(22)18(20-14)13-16-10-6-3-7-11-16/h2-11H,12-13H2,1H3,(H,21,22)
InChIKey: JWGCXKPKEBPFNG-UHFFFAOYSA-N
Reference
Nannozinones and Sorazinones, Unprecedented Pyrazinones from Myxobacteria
PubChem CID: 10565431
LOTUS: LTS0272743
NPASS: NPC473498
COCONUT: CNP0148471
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 290.366
TPSA？: 45.75
MolLogP？: 3.259920000000001
Number of H-Donors: 1
Number of H-Acceptors: 2
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Candida albicans | Candida albicans | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Chromobacterium violaceum | Chromobacterium violaceum | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Escherichia coli | Escherichia coli | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Homo sapiens | A549 | IC50 | 34500.0 | nM | 10.1021/np500632c |
| Homo sapiens | MCF7 | IC50 | 34500.0 | nM | 10.1021/np500632c |
| Homo sapiens | Plasminogen | IC50 | nan | nM | 10.1016/s0960-894x(00)00431-5 |
| Mucor hiemalis | Mucor hiemalis | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Mus musculus | L929 | IC50 | 34500.0 | nM | 10.1021/np500632c |
| Mycolicibacterium diernhoferi | Mycolicibacterium diernhoferi | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Nocardia sp. | Nocardia sp. | MIC | 67.0 | ug.mL-1 | 10.1021/np500632c |
| Paenibacillus polymyxa | Paenibacillus polymyxa | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Wickerhamomyces anomalus | Wickerhamomyces anomalus | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| None | NON-PROTEIN TARGET | IC50 | 34500.0 | nM | 10.1021/np500632c |
| None | NON-PROTEIN TARGET | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| None | Unchecked | IC50 | nan | nM | 10.1016/s0960-894x(00)00431-5 |