Nannozinone A
AlkaPlorer ID: AK077440
Synonym: 'Nannozinone A'
IUPAC Name: 1-(2-phenylethyl)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazin-4-one
Structure
SMILES: O=C1C=NC(CCC2=CC=CC=C2)=C2CCCN21
InChI: InChI=1S/C15H16N2O/c18-15-11-16-13(14-7-4-10-17(14)15)9-8-12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-10H2
InChIKey: YCDNFIFPTPRDLT-UHFFFAOYSA-N
Reference
Nannozinones and Sorazinones, Unprecedented Pyrazinones from Myxobacteria
PubChem CID: 101889902
LOTUS: LTS0118800
NPASS: NPC472258
COCONUT: CNP0353295
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 240.306
TPSA？: 34.89
MolLogP？: 1.9747
Number of H-Donors: 0
Number of H-Acceptors: 3
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Candida albicans | Candida albicans | MIC | 33.3 | ug.mL-1 | 10.1021/np500632c |
| Chromobacterium violaceum | Chromobacterium violaceum | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Escherichia coli | Escherichia coli | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Homo sapiens | A-431 | IC50 | 41500.0 | nM | 10.1021/np500632c |
| Homo sapiens | A549 | IC50 | 41500.0 | nM | 10.1021/np500632c |
| Homo sapiens | HUVEC | IC50 | 41500.0 | nM | 10.1021/np500632c |
| Homo sapiens | MCF7 | IC50 | 41500.0 | nM | 10.1021/np500632c |
| Mucor hiemalis | Mucor hiemalis | MIC | 33.3 | ug.mL-1 | 10.1021/np500632c |
| Mus musculus | L929 | IC50 | 41500.0 | nM | 10.1021/np500632c |
| Mycolicibacterium diernhoferi | Mycolicibacterium diernhoferi | MIC | 33.3 | ug.mL-1 | 10.1021/np500632c |
| Nocardia sp. | Nocardia sp. | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Paenibacillus polymyxa | Paenibacillus polymyxa | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| Wickerhamomyces anomalus | Wickerhamomyces anomalus | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |
| None | NON-PROTEIN TARGET | IC50 | 41500.0 | nM | 10.1021/np500632c |
| None | NON-PROTEIN TARGET | MIC | 66.6 | ug.mL-1 | 10.1021/np500632c |