Spirostaphylotrichin X
AlkaPlorer ID: AK080410
Synonym: None
IUPAC Name: (3S,4R,5S,6Z,10S)-4,10-dihydroxy-2,3-dimethoxy-3-methyl-6-propylidene-2-azaspiro[4.5]dec-7-ene-1,9-dione
Structure
SMILES: CC/C=C1/C=CC(=O)[C@@H](O)[C@]12C(=O)N(OC)[C@@](C)(OC)[C@@H]2O
InChI: InChI=1S/C15H21NO6/c1-5-6-9-7-8-10(17)11(18)15(9)12(19)14(2,21-3)16(22-4)13(15)20/h6-8,11-12,18-19H,5H2,1-4H3/b9-6-/t11-,12+,14+,15-/m1/s1
InChIKey: WLTPKEUARATQBE-KIIIIJNPSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 311.334
TPSA？: 96.3
MolLogP？: -0.0639000000000004
Number of H-Donors: 2
Number of H-Acceptors: 6
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Arabidopsis thaliana | Arabidopsis thaliana | Inhibition | nan | % | 10.1021/acs.jnatprod.8b00656 |
| Canis lupus familiaris | MDCK | CC50 | 200000.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Cynodon dactylon | Cynodon dactylon | Inhibition | nan | % | 10.1021/acs.jnatprod.8b00656 |
| Erysipelothrix rhusiopathiae | Erysipelothrix rhusiopathiae | MIC | 100.0 | ug.mL-1 | 10.1021/acs.jnatprod.8b00656 |
| Escherichia coli | Escherichia coli | MIC | 100.0 | ug.mL-1 | 10.1021/acs.jnatprod.8b00656 |
| Homo sapiens | 786-0 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Homo sapiens | ACHN | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Homo sapiens | HepG2 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Homo sapiens | OS-RC-2 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Homo sapiens | SGC-7901 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus | Influenza A virus | Activity | nan | None | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus | Influenza A virus | IC50 | 1200.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus | Influenza A virus | IC50 | 1600.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus | Influenza A virus | IC50 | 1700.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus | Influenza A virus | IC50 | 5500.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus (A/Puerto Rico/8/1934(H1N1)) | Hemagglutinin | Inhibition | nan | % | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus (A/Puerto Rico/8/1934(H1N1)) | Neuraminidase | Inhibition | nan | % | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus H3N2 | Influenza A virus H3N2 | IC50 | 4100.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus (strain A/Puerto Rico/8/1934 H1N1) | Polymerase basic protein 2 | Inhibition | nan | % | 10.1021/acs.jnatprod.8b00656 |
| Influenza A virus (strain A/Puerto Rico/8/1934 H1N1) | Polymerase basic protein 2 | Kd | 77.0 | nM | 10.1021/acs.jnatprod.8b00656 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 100.0 | ug.mL-1 | 10.1021/acs.jnatprod.8b00656 |
| None | Unchecked | Inhibition | nan | % | 10.1021/acs.jnatprod.8b00656 |
| None | Unchecked | MIC | 100.0 | ug.mL-1 | 10.1021/acs.jnatprod.8b00656 |