Isoschizogaline
AlkaPlorer ID: AK092492
Synonym: None
IUPAC Name: (1S,8R,16S,17R)-12-methoxy-5,15-diazahexacyclo[13.4.2.01,16.05,16.08,17.09,14]henicosa-2,9(14),10,12-tetraen-21-one
Structure
SMILES: COC1=CC=C2C(=C1)N1C(=O)C[C@]34C=CCN5CC[C@@H]2[C@@H](CC3)[C@]514
InChI: InChI=1S/C20H22N2O2/c1-24-13-3-4-15-14-6-10-21-9-2-7-19-8-5-16(14)20(19,21)22(17(15)11-13)18(23)12-19/h2-4,7,11,14,16H,5-6,8-10,12H2,1H3/t14-,16+,19-,20-/m0/s1
InChIKey: GHZIYRPRBMQWSP-ZXUOCUECSA-N
Reference
Alkaloide ausSchizozygia caffaeoides (Boj.) Baill.
PubChem CID: 636755
LOTUS: LTS0200205
NPASS: NPC473569
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Schizozygia | Apocynaceae | Gentianales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 322.4080000000001
TPSA？: 32.78
MolLogP？: 2.8973000000000013
Number of H-Donors: 0
Number of H-Acceptors: 3
RingCount: 6
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | MIC | 62.5 | ug.mL-1 | 10.1021/np010298m |
| Candida albicans | Candida albicans | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Cladosporium cladosporioides | Cladosporium cladosporioides | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Cladosporium herbarum | Cladosporium herbarum | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Epidermophyton floccosum | Epidermophyton floccosum | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Escherichia coli | Escherichia coli | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Nannizzia gypsea | Nannizzia gypsea | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 125.0 | ug.mL-1 | 10.1021/np010298m |
| Trichophyton interdigitale | Trichophyton interdigitale | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Trichophyton tonsurans | Trichophyton tonsurans | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |