(3S,9S,12S,15S,21S,24S,27S)-12-benzyl-21-[(1S)-1-hydroxyethyl]-9-isopropyl-24-methyl-1,7,10,13,19,22,25-heptaazatetracyclo[25.3.0.0³,⁷.0¹⁵,¹⁹]triacontane-2,8,11,14,20,23,26-heptone
AlkaPlorer ID: AK093608
Synonym: None
IUPAC Name: (3S,9S,12S,15S,21S,24S,27S)-12-benzyl-21-[(1R)-1-hydroxyethyl]-24-methyl-9-propan-2-yl-1,7,10,13,19,22,25-heptazatetracyclo[25.3.0.03,7.015,19]triacontane-2,8,11,14,20,23,26-heptone
Structure
SMILES: CC(C)[C@@H]1N=C(O)[C@H](CC2=CC=CC=C2)N=C(O)[C@@H]2CCCN2C(=O)[C@H]([C@@H](C)O)N=C(O)[C@H](C)N=C(O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C1=O
InChI: InChI=1S/C36H51N7O8/c1-20(2)28-35(50)43-18-10-15-27(43)34(49)41-16-8-13-25(41)32(47)37-21(3)30(45)40-29(22(4)44)36(51)42-17-9-14-26(42)33(48)38-24(31(46)39-28)19-23-11-6-5-7-12-23/h5-7,11-12,20-22,24-29,44H,8-10,13-19H2,1-4H3,(H,37,47)(H,38,48)(H,39,46)(H,40,45)/t21-,22+,24-,25-,26-,27-,28-,29-/m0/s1
InChIKey: ZLFKJRJBRWMMMG-HHRCTJKHSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Prosuberites laughlini | Prosuberites | Suberitidae | Suberitida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 709.8449999999998
TPSA?: 211.52
MolLogP?: 2.5728000000000044
Number of H-Donors: 5
Number of H-Acceptors: 8
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Hepatitis B virus | Hepatitis B virus | Activity | nan | None | 10.1021/np9004135 |
| Homo sapiens | IGROV-1 | Activity | 91.3 | % | 10.1021/np9004135 |
| Homo sapiens | LOX IMVI | Activity | 88.6 | % | 10.1021/np9004135 |
| Homo sapiens | NCI-H522 | Activity | 83.9 | % | 10.1021/np9004135 |
| Homo sapiens | UO-31 | Activity | 76.3 | % | 10.1021/np9004135 |
| Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | Activity | nan | None | 10.1021/np9004135 |
| Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | Activity | nan | None | 10.1021/np9004135 |
| Influenza A virus | Influenza A virus | Activity | nan | None | 10.1021/np9004135 |
| Influenza B virus | Influenza B virus | Activity | nan | None | 10.1021/np9004135 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | Activity | nan | None | 10.1021/np9004135 |
| Plasmodium falciparum | Plasmodium falciparum | Activity | nan | None | 10.1021/np9004135 |
| Respiratory syncytial virus | Respiratory syncytial virus | Activity | nan | None | 10.1021/np9004135 |
| Rift Valley fever virus | Rift Valley fever virus | Activity | nan | None | 10.1021/np9004135 |
| West Nile virus | West Nile virus | Activity | nan | None | 10.1021/np9004135 |
| None | NON-PROTEIN TARGET | Activity | nan | None | 10.1021/np9004135 |
