Onychine
AlkaPlorer ID: AK105755
Synonym: None
IUPAC Name: 4-methylindeno[1,2-b]pyridin-5-one
Structure
SMILES: CC1=CC=NC2=C1C(=O)C1=CC=CC=C12
InChI: InChI=1S/C13H9NO/c1-8-6-7-14-12-9-4-2-3-5-10(9)13(15)11(8)12/h2-7H,1H3
InChIKey: LTVBTVOAUQJJEV-UHFFFAOYSA-N
Reference
Alkaloids From Fumaria macrocarpa
PubChem CID: 72584
CAS: 58787-04-5
LOTUS: LTS0062903
SuperNatural Ⅲ: SN0215244
COCONUT: CNP0079922
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Guatteria blepharophylla | Guatteria | Annonaceae | Magnoliales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 195.221
TPSA？: 29.96
MolLogP？: 2.601420000000001
Number of H-Donors: 0
Number of H-Acceptors: 2
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus niger | Aspergillus niger | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Bacillus subtilis | Bacillus subtilis | MIC | 50.0 | ug.mL-1 | 10.1021/np100536a |
| Bacillus subtilis | Bacillus subtilis | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Candida albicans | Candida albicans | Activity | nan | None | 10.1021/np50053a037 |
| Candida albicans | Candida albicans | MIC | 3.12 | ug.mL-1 | 10.1021/np100536a |
| Cyberlindnera jadinii | Cyberlindnera jadinii | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Escherichia coli | Escherichia coli | MIC | 50.0 | ug.mL-1 | 10.1021/np100536a |
| Escherichia coli | Escherichia coli | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Homo sapiens | Raji | Activity | 70.0 | % | 10.1021/np50065a012 |
| Homo sapiens | Raji | Activity | 80.0 | % | 10.1021/np50065a012 |
| Mucor mucedo | Mucor mucedo | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Proteus vulgaris | Proteus vulgaris | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Rhizopus microsporus var. chinensis | Rhizopus microsporus var. chinensis | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Rhodotorula mucilaginosa | Rhodotorula mucilaginosa | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 50.0 | ug.mL-1 | 10.1021/np100536a |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Schizosaccharomyces pombe | Schizosaccharomyces pombe | MIC | 50.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 50.0 | ug.mL-1 | 10.1021/np100536a |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 100.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| None | NON-PROTEIN TARGET | MIC | 50.0 | ug.mL-1 | 10.1016/j.bmcl.2004.12.059 |
| None | Unchecked | Inhibition | 55.5 | % | 10.1021/np50065a012 |
| None | Unchecked | Inhibition | 94.1 | % | 10.1021/np50065a012 |
| None | Unchecked | Inhibition | 100.0 | % | 10.1021/np50065a012 |