Not named
AlkaPlorer ID: AK113592
Synonym: 'JBIR-03'
IUPAC Name: (1S,2S,5S,7R,9S,10R,13S)-1,2,9-trimethyl-7-(2-methylprop-1-enyl)-6-oxa-22-azahexacyclo[11.10.0.02,10.05,9.015,23.016,21]tricosa-15(23),16,18,20-tetraene
Structure
SMILES: CC(C)=C[C@H]1C[C@]2(C)[C@H](CC[C@@]3(C)[C@H]2CC[C@H]2CC4=C(NC5=CC=CC=C45)[C@@]23C)O1
InChI: InChI=1S/C28H37NO/c1-17(2)14-19-16-26(3)23-11-10-18-15-21-20-8-6-7-9-22(20)29-25(21)28(18,5)27(23,4)13-12-24(26)30-19/h6-9,14,18-19,23-24,29H,10-13,15-16H2,1-5H3/t18-,19-,23-,24-,26-,27-,28+/m0/s1
InChIKey: WQLADPPAYVUSAB-VSUSBFIXSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Aspergillus oryzae | Aspergillus | Aspergillaceae | Eurotiales | Eurotiomycetes | Ascomycota | Fungi | Eukaryota |
Properties Information
Molecule Weight: 403.61000000000007
TPSA?: 25.02
MolLogP?: 6.938000000000008
Number of H-Donors: 1
Number of H-Acceptors: 1
RingCount: 6
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Artemia salina | Artemia salina | Activity | 74.2 | % | 10.1016/j.bmcl.2010.08.024 |
| Colletotrichum lagenaria | Colletotrichum lagenaria | Activity | nan | None | 10.1016/j.bmcl.2010.08.024 |
| Escherichia coli | Escherichia coli | DIZ | nan | None | 10.1016/j.bmcl.2010.08.024 |
| Fusarium oxysporum | Fusarium oxysporum | Activity | nan | None | 10.1016/j.bmcl.2010.08.024 |
| Homo sapiens | Acetylcholinesterase | Inhibition | -7.6 | % | 10.1016/j.bmcl.2010.08.024 |
| Homo sapiens | Cannabinoid CB1 receptor | Ki | 4400.0 | nM | 10.1021/np400850g |
| Homo sapiens | Cannabinoid CB2 receptor | Ki | 4760.0 | nM | 10.1021/np400850g |
| Homo sapiens | G-protein coupled receptor 55 | IC50 | 10000.0 | nM | 10.1021/np400850g |
| Homo sapiens | G-protein coupled receptor 55 | Inhibition | 0.0 | % | 10.1021/np400850g |
| Homo sapiens | N-arachidonyl glycine receptor | IC50 | 9910.0 | nM | 10.1021/np400850g |
| Zika virus | Zika virus | EC50 | 4200.0 | nM | 10.1021/acs.jnatprod.0c00717 |
