1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H,4H,7H-pyrazolo[3,4-d]pyrimidin-4-one
AlkaPlorer ID: AK117907
Synonym: None
IUPAC Name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-pyrazolo[3,4-d]pyrimidin-4-one
Structure
SMILES: O=C1N=CNC2=C1C=NN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O
InChI: InChI=1S/C10H12N4O5/c15-2-5-6(16)7(17)10(19-5)14-8-4(1-13-14)9(18)12-3-11-8/h1,3,5-7,10,15-17H,2H2,(H,11,12,18)/t5-,6-,7-,10-/m1/s1
InChIKey: KFQUAMTWOJHPEJ-DAGMQNCNSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Trypanosoma brucei | Trypanosoma | Trypanosomatidae | Trypanosomatida | Kinetoplastea | Euglenozoa | None | Eukaryota |
Properties Information
Molecule Weight: 268.229
TPSA?: 133.49
MolLogP?: -2.2689
Number of H-Donors: 4
Number of H-Acceptors: 8
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Chlorocebus sabaeus | Vero | Virus rating | 0.0 | None | 10.1021/jm00375a006 |
| Chlorocebus sabaeus | Vero | Virus rating | 0.2 | None | 10.1021/jm00375a006 |
| Chlorocebus sabaeus | Vero | Virus rating | 0.3 | None | 10.1021/jm00375a006 |
| Eimeria tenella | Eimeria tenella | MIC | 20.0 | ug.mL-1 | 10.1021/jm00351a007 |
| Gallus gallus | Gallus gallus | No. of chicks | 0.0 | None | 10.1021/jm00351a007 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 7.8 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 20.75 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Purine nucleoside phosphorylase | Inhibition | 8.0 | % | 10.1016/s0960-894x(02)00064-1 |
| Homo sapiens | Purine nucleoside phosphorylase | Inhibition | 11.0 | % | 10.1016/s0960-894x(02)00064-1 |
| Homo sapiens | Purine nucleoside phosphorylase | Inhibition | 22.0 | % | 10.1016/s0960-894x(02)00064-1 |
| Homo sapiens | Purine nucleoside phosphorylase | Inhibition | 28.0 | % | 10.1016/s0960-894x(02)00064-1 |
| Homo sapiens | Purine nucleoside phosphorylase | Ki | 1800000.0 | nM | 10.1016/s0960-894x(02)00064-1 |
| Homo sapiens | Purine nucleoside phosphorylase | Ki | 2000000.0 | nM | 10.1016/s0960-894x(02)00064-1 |
| Leishmania infantum | Leishmania infantum | IC50 | 6660.0 | nM | 10.1021/acs.jmedchem.1c00135 |
| Leishmania tropica | Leishmania tropica | ED50 | 76.0 | uM | 10.1021/jm00375a006 |
| Mus musculus | L1210 | ILS | 2.0 | None | 10.1021/jm00142a009 |
| Mus musculus | L1210 | Toxicity | nan | None | 10.1021/jm00142a009 |
| Mus musculus | Peritoneal macrophage | CC50 | 64000.0 | nM | 10.1021/acs.jmedchem.1c00135 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 16.09 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | -5.55 | % | 10.21203/rs.3.rs-23951/v1 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.0 | % | 10.6019/CHEMBL4495565 |
| Trypanosoma cruzi | Trypanosoma cruzi | IC50 | 7180.0 | nM | 10.1021/acs.jmedchem.1c00135 |
| None | ADMET | Ratio CC50/IC50 | 9.0 | None | 10.1021/acs.jmedchem.1c00135 |
| None | ADMET | Ratio CC50/IC50 | 10.0 | None | 10.1021/acs.jmedchem.1c00135 |
| None | ADMET | Toxic level | 0.005 | M | 10.1021/jm00375a006 |
| None | Unchecked | CC50 | 64000.0 | nM | 10.1021/acs.jmedchem.1c00135 |
