(2R,3R,4R,5R)-2-(hydroxymethyl)-5-[(2S)-2-hydroxypropyl]pyrrolidine-3,4-diol
AlkaPlorer ID: AK147807
Synonym: None
IUPAC Name: (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2-hydroxypropyl)pyrrolidine-3,4-diol
Structure
SMILES: CC(O)C[C@H]1N[C@H](CO)[C@@H](O)[C@@H]1O
InChI: InChI=1S/C8H17NO4/c1-4(11)2-5-7(12)8(13)6(3-10)9-5/h4-13H,2-3H2,1H3/t4?,5-,6-,7-,8-/m1/s1
InChIKey: SKCBFFYDHKQEQU-NMBMWNOXSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Scilla peruviana | Scilla | Hyacinthaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 191.22700000000003
TPSA？: 92.95
MolLogP？: -2.188199999999999
Number of H-Donors: 5
Number of H-Acceptors: 5
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bos taurus | Alpha-L-fucosidase 1 | Inhibition | 50.0 | % | 10.1021/np0499721 |
| Bos taurus | Beta-galactosidase | IC50 | 260000.0 | nM | 10.1021/np0499721 |
| Coffea arabica | Alpha-galactosidase | Inhibition | 50.0 | % | 10.1021/np0499721 |
| Homo sapiens | Beta-glucocerebrosidase | Inhibition | 50.0 | % | 10.1021/np0499721 |
| Rattus norvegicus | Acidic alpha-glucosidase | Inhibition | 50.0 | % | 10.1021/np0499721 |
| Rattus norvegicus | Beta-mannosidase | IC50 | 610000.0 | nM | 10.1021/np0499721 |
| None | Unchecked | IC50 | 100000.0 | nM | 10.1021/np0499721 |
| None | Unchecked | IC50 | 210000.0 | nM | 10.1021/np0499721 |
| None | Unchecked | IC50 | 700000.0 | nM | 10.1021/np0499721 |
| None | Unchecked | Inhibition | 50.0 | % | 10.1021/np0499721 |