1-ethyl-4-methanesulfonyl-9H-carbazole
AlkaPlorer ID: AK151287
Synonym: None
IUPAC Name: 1-ethyl-4-methylsulfonyl-9H-carbazole
Structure
SMILES: CCC1=C2NC3=CC=CC=C3C2=C(S(C)(=O)=O)C=C1
InChI: InChI=1S/C15H15NO2S/c1-3-10-8-9-13(19(2,17)18)14-11-6-4-5-7-12(11)16-15(10)14/h4-9,16H,3H2,1-2H3
InChIKey: LIGSBFUNSYSFNL-UHFFFAOYSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Cribricellina cribraria | Cribricellina | Catenicellidae | Cheilostomatida | Gymnolaemata | Bryozoa | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 273.357
TPSA？: 49.93
MolLogP？: 3.2870000000000017
Number of H-Donors: 1
Number of H-Acceptors: 2
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Amorphotheca resinae | Amorphotheca resinae | MIC | 60.0 | ug | 10.1021/np50076a023 |
| Bacillus subtilis | Bacillus subtilis | MIC | 30.0 | ug | 10.1021/np50076a023 |
| Candida albicans | Candida albicans | MIC | 60.0 | ug | 10.1021/np50076a023 |
| Escherichia coli | Escherichia coli | MIC | 60.0 | ug | 10.1021/np50076a023 |
| Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | IZ | nan | None | 10.1021/np50076a023 |
| Mus musculus | P388 | IC50 | 12.5 | ug.mL-1 | 10.1021/np50076a023 |
| Poliovirus 1 | Poliovirus 1 | IZ | nan | None | 10.1021/np50076a023 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 60.0 | ug | 10.1021/np50076a023 |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | 30.0 | ug | 10.1021/np50076a023 |
| None | ADMET | IZ | nan | None | 10.1021/np50076a023 |