Brachystamide B; (E,E,E)-form
AlkaPlorer ID: AK290936
Synonym: None
IUPAC Name: (2E,4E,14E)-15-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pentadeca-2,4,14-trienamide
Structure
SMILES: CC(C)CN=C(O)/C=C/C=C/CCCCCCCC/C=C/C1=CC=C2OCOC2=C1
InChI: InChI=1S/C26H37NO3/c1-22(2)20-27-26(28)16-14-12-10-8-6-4-3-5-7-9-11-13-15-23-17-18-24-25(19-23)30-21-29-24/h10,12-19,22H,3-9,11,20-21H2,1-2H3,(H,27,28)/b12-10+,15-13+,16-14+
InChIKey: DRMOIHOBUYFDKF-HMZUNPFJSA-N
Reference
PubChem CID: 10047263
CAS: 126394-65-8
LOTUS: LTS0107330
SuperNatural Ⅲ: SN0073505-01
NPASS: NPC41331
data_source: manually
Source
Properties Information
Molecule Weight: 411.5860000000001
TPSA?: 51.05000000000001
MolLogP?: 7.274200000000007
Number of H-Donors: 1
Number of H-Acceptors: 3
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Mus musculus | 3T3-L1 | Activity | 11.1 | % | 10.1016/j.bmcl.2008.04.052 |
| Mus musculus | 3T3-L1 | Activity | 13.7 | % | 10.1016/j.bmcl.2008.04.052 |
| Mus musculus | 3T3-L1 | Activity | 16.8 | % | 10.1016/j.bmcl.2008.04.052 |
| Mus musculus | 3T3-L1 | Activity | 18.5 | % | 10.1016/j.bmcl.2008.04.052 |
| Mus musculus | Hepatocyte | Inhibition | -22.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | Hepatocyte | Inhibition | -17.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | Hepatocyte | Inhibition | -6.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | Hepatocyte | Inhibition | -6.0 | % | 10.1016/j.bmcl.2008.01.101 |
| Mus musculus | Hepatocyte | Inhibition | 10.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | Hepatocyte | Inhibition | 11.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | Hepatocyte | Inhibition | 11.0 | % | 10.1016/j.bmcl.2008.01.101 |
| Mus musculus | Hepatocyte | Inhibition | 18.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | Hepatocyte | Inhibition | 22.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | Hepatocyte | Inhibition | 22.0 | % | 10.1016/j.bmcl.2008.01.101 |
| Mus musculus | L929 | Inhibition | -15.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | L929 | Inhibition | -11.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | L929 | Inhibition | 1.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mus musculus | L929 | Inhibition | 4.0 | % | 10.1016/j.bmc.2009.08.050 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 50.0 | ug.mL-1 | 10.1016/j.ejmech.2011.12.029 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 50.0 | ug.mL-1 | 10.1016/j.ejmech.2017.06.005 |
