2,4-Decadienoic acid; (E,E)-form, 2-Phenylethylamide
AlkaPlorer ID: AK294597
Synonym: 2,4-Decadienoic acid 2-phenylethylamide
IUPAC Name: (2E,4Z)-N-(2-phenylethyl)deca-2,4-dienamide
Structure
SMILES: CCCCC/C=C\C=C\C(=O)NCCC1=CC=CC=C1
InChI: InChI=1S/C18H25NO/c1-2-3-4-5-6-7-11-14-18(20)19-16-15-17-12-9-8-10-13-17/h6-14H,2-5,15-16H2,1H3,(H,19,20)/b7-6-,14-11+
InChIKey: JDDRCLDJHAZTTI-CVWCMPNTSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Achillea wilhelmsii | Achillea | Asteraceae | Asterales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Anacyclus pyrethrum | Anacyclus | Asteraceae | Asterales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 271.40399999999994
TPSA？: 29.1
MolLogP？: 4.038000000000003
Number of H-Donors: 1
Number of H-Acceptors: 1
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Mus musculus | Inhibitor of nuclear factor kappa-B kinase subunit alpha | Inhibition | nan | % | 10.1021/acs.jnatprod.1c00146 |
| Mus musculus | Inhibitor of nuclear factor kappa-B kinase subunit beta | Inhibition | nan | % | 10.1021/acs.jnatprod.1c00146 |
| Mus musculus | RAW264.7 | Activity | nan | None | 10.1021/acs.jnatprod.1c00146 |
| Mus musculus | RAW264.7 | IC50 | 13300.0 | nM | 10.1021/acs.jnatprod.1c00146 |
| None | Unchecked | IC50 | 21600.0 | nM | 10.1021/acs.jnatprod.1c00146 |
| None | Unchecked | Inhibition | nan | % | 10.1021/acs.jnatprod.1c00146 |