2,7-Dihydroxy-2H-1,4-benzoxazin-3(4H)-one; (R)-form, 7-Me ether
AlkaPlorer ID: AK296079
Synonym: 2-Hydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one, HMBOA
IUPAC Name: 2-hydroxy-7-methoxy-4H-1,4-benzoxazin-3-one
Structure
SMILES: COC1=CC=C2N=C(O)C(O)OC2=C1
InChI: InChI=1S/C9H9NO4/c1-13-5-2-3-6-7(4-5)14-9(12)8(11)10-6/h2-4,9,12H,1H3,(H,10,11)
InChIKey: NDEPTLCFICMYLH-UHFFFAOYSA-N
Reference
PubChem CID: 152213
CAS: 17359-53-4
LOTUS: LTS0161763
NPASS: NPC473769
COCONUT: CNP0275227.1
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Hordeum vulgare | Hordeum | Poaceae | Poales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | Agropyron | Poaceae | Poales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Zea mays | Zea | Poaceae | Poales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | Coix | Poaceae | Poales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | Agropyron | Poaceae | Poales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 195.174
TPSA?: 71.28
MolLogP?: 0.9939999999999998
Number of H-Donors: 2
Number of H-Acceptors: 4
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Candida albicans | Candida albicans | MIC | 5123600.0 | nM | 10.1016/j.bmc.2018.11.016 |
| Mus musculus | Mast cell | ID50 | 6.0 | 10'-5M | 10.1021/np50055a009 |
| Mus musculus | Mast cell | Inhibition | 85.5 | % | 10.1021/np50055a009 |
| Mus musculus | Mast cell | Inhibition | 91.3 | % | 10.1021/np50055a009 |
| Rhopalosiphum padi | Rhopalosiphum padi | Activity | 35.0 | % | 10.1021/jf030766t |
