2-Hydroxy-2H-1,4-benzoxazin-3(4H)-one; (R)-form, N-Hydroxy
AlkaPlorer ID: AK300862
Synonym: 2,4-Dihydroxy-2H-1,4-benzoxazin-3(4H)-one, DIBOA
IUPAC Name: 2,4-dihydroxy-1,4-benzoxazin-3-one
Structure
SMILES: O=C1C(O)OC2=C(C=CC=C2)N1O
InChI: InChI=1S/C8H7NO4/c10-7-8(11)13-6-4-2-1-3-5(6)9(7)12/h1-4,8,11-12H
InChIKey: COVOPZQGJGUPEY-UHFFFAOYSA-N
Reference
PubChem CID: 28495
CAS: 17359-54-5
LOTUS: LTS0222426
NPASS: NPC168750
COCONUT: CNP0423168.2
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Acanthus ilicifolius | Acanthus | Acanthaceae | Lamiales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 181.147
TPSA?: 70.0
MolLogP?: 0.1195999999999999
Number of H-Donors: 2
Number of H-Acceptors: 4
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Abutilon theophrasti | Abutilon theophrasti | Activity | 0.0 | % | 10.1021/np50037a010 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | 6.0 | % | 10.1021/np50037a010 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | 40.0 | % | 10.1021/np50037a010 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | 59.0 | % | 10.1021/np50037a010 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | 72.0 | % | 10.1021/np50037a010 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | 82.0 | % | 10.1021/np50037a010 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | 97.0 | % | 10.1021/np50037a010 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | nan | None | 10.1021/np50037a010 |
| Candida albicans | Candida albicans | MIC | 3676600.0 | nM | 10.1016/j.bmc.2018.11.016 |
| Escherichia coli | Escherichia coli | MIC | 6900500.0 | nM | 10.1016/j.bmc.2018.11.016 |
| Rhopalosiphum padi | Rhopalosiphum padi | Activity | 92.3 | % | 10.1021/jf030766t |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 2760200.0 | nM | 10.1016/j.bmc.2018.11.016 |
