5-Hydroxytryptamine; Nb-(4-Hydroxy-Z-cinnamoyl)
AlkaPlorer ID: AK302125
Synonym: Nb-cis-p-Coumaroylserotonin
IUPAC Name: (E)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-(4-hydroxyphenyl)prop-2-enamide
Structure
SMILES: OC(/C=C/C1=CC=C(O)C=C1)=NCCC1=CNC2=CC=C(O)C=C12
InChI: InChI=1S/C19H18N2O3/c22-15-4-1-13(2-5-15)3-8-19(24)20-10-9-14-12-21-18-7-6-16(23)11-17(14)18/h1-8,11-12,21-23H,9-10H2,(H,20,24)/b8-3+
InChIKey: WLZPAFGVOWCVMG-FPYGCLRLSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Phragmites australis | Phragmites | Poaceae | Poales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 322.36400000000003
TPSA？: 88.84
MolLogP？: 3.791500000000001
Number of H-Donors: 4
Number of H-Acceptors: 3
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Agaricus bisporus | Tyrosinase | IC50 | 8800.0 | nM | 10.1016/j.bmcl.2011.02.028 |
| Homo sapiens | Cyclooxygenase-1 | Inhibition | 12.5 | % | 10.1016/j.bmcl.2012.02.002 |
| Homo sapiens | Cyclooxygenase-2 | Inhibition | 13.9 | % | 10.1016/j.bmcl.2012.02.002 |
| Homo sapiens | Monoamine oxidase B | EC50 | 1200.0 | nM | 10.1016/j.ejmech.2019.07.064 |
| Mus musculus | RAW264.7 | Activity | nan | None | 10.1016/j.bmcl.2017.10.035 |
| Mus musculus | RAW264.7 | IC50 | 43220.0 | nM | 10.1016/j.bmcl.2017.10.035 |
| Mus musculus | RAW264.7 | IC50 | 164430.0 | nM | 10.1016/j.bmcl.2017.10.035 |
| Saccharomyces cerevisiae | Alpha-glucosidase MAL62 | IC50 | 47200.0 | nM | 10.1007/s00044-011-9699-9 |
| Saccharomyces cerevisiae | Alpha-glucosidase MAL62 | Inhibition | nan | % | 10.1007/s00044-011-9699-9 |
| Saccharomyces cerevisiae | Alpha-glucosidase MAL62 | Ki | 81600.0 | nM | 10.1007/s00044-011-9699-9 |
| None | Radical scavenging activity | EC50 | 24700.0 | nM | 10.1016/j.bmcl.2011.02.028 |