Taxol; 7-Epimer
AlkaPlorer ID: AK315045
Synonym: 7-Epitaxol
IUPAC Name: [4,12-diacetyloxy-15-(3-benzamido-2-hydroxy-3-phenylpropanoyl)oxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate
Structure
SMILES: CC(=O)OC1C(=O)C2(C)C(O)CC3OCC3(OC(C)=O)C2C(OC(=O)C2=CC=CC=C2)C2(O)CC(OC(=O)C(O)C(N=C(O)C3=CC=CC=C3)C3=CC=CC=C3)C(C)=C1C2(C)C
InChI: InChI=1S/C47H51NO14/c1-25-31(60-43(56)36(52)35(28-16-10-7-11-17-28)48-41(54)29-18-12-8-13-19-29)23-47(57)40(61-42(55)30-20-14-9-15-21-30)38-45(6,32(51)22-33-46(38,24-58-33)62-27(3)50)39(53)37(59-26(2)49)34(25)44(47,4)5/h7-21,31-33,35-38,40,51-52,57H,22-24H2,1-6H3,(H,48,54)
InChIKey: RCINICONZNJXQF-UHFFFAOYSA-N
Reference
PubChem CID: 4666
CAS: 33069-62-4
LOTUS: LTS0151890
NPASS: NPC307628
COCONUT: CNP0379287.17
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Punica granatum | Punica | Lythraceae | Myrtales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Torreya grandis | Torreya | Taxaceae | Cupressales | Pinopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 853.9180000000001
TPSA？: 224.78
MolLogP？: 4.310500000000005
Number of H-Donors: 4
Number of H-Acceptors: 14
RingCount: 7
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | Bromodomain-containing protein 4 | Delta TM | -0.86 | C | None |
| Homo sapiens | Casein kinase I delta | Delta TM | -0.12 | C | None |
| Homo sapiens | Cyclin-dependent kinase 2 | Delta TM | 0.71 | C | None |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 58.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 231110.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 53.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 72.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 37.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 55.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 59.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 99.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 127.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 131.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 198.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 199.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 205.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 208.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 211.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 212.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 216.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 230.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 242.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 14985.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 15057.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 15078.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 15171.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 16285.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 16485.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 16657.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 17835.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Growth Rate | -0.93 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | -0.73 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | -0.65 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | -0.57 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | -0.4 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | -0.32 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | 0.02 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | 0.16 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 36.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 39.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 42.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 43.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 43.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 51.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 53.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 54.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 68.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 71.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 75.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 76.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 82.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 84.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 86.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 92.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 31.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 36.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 48.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 58.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 38.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 39.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 42.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 43.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 47.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 53.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 58.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 58.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 61.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 63.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 63.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 24.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 37.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 43.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 45.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 48.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 73.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 58.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Normal (%) | 100.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 100.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 24.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 28.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 44.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 48.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 54.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 73.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 77.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 80.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 84.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 87.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 93.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 99.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 100.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 104.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 110.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 111.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 113.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 114.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 115.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 120.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 122.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 125.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 128.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 129.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 134.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 137.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 142.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 145.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 146.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 149.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 150.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 151.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 151.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 155.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 159.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 161.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 164.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 167.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 169.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 171.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 173.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 177.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 177.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 180.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 186.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 189.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 198.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 200.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 210.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 212.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 220.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 221.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 224.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 228.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 246.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 250.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 252.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 264.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 277.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 281.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 285.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 291.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 304.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 312.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 333.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast growth factor receptor 3 | Delta TM | -0.05 | C | None |
| Homo sapiens | Glycogen synthase kinase-3 beta | Delta TM | -0.92 | C | None |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 61.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 79.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 36.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 59.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 83.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 54.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 55.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 77.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 85.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 45.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 364.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 370.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 680.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 681.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 691.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 838.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 865.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 1046.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 1069.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 1080.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 1765.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 2439.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 2812.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 3025.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 22878.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 29842.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 35035.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 45150.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 45535.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 60692.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 68271.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 101135.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 20.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 47.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 48.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Growth Rate | -0.59 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | -0.58 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | -0.24 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | -0.18 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | -0.17 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | -0.1 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | -0.03 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 32.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 34.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 36.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 45.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 47.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 49.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 51.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 55.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 57.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 64.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 65.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 68.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 69.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 71.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 43.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 79.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 88.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 89.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 39.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 43.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 44.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 45.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 48.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 58.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 72.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 75.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 78.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 79.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 84.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 85.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 87.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 26.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 35.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 39.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 43.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 44.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 48.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 48.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 54.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 65.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 67.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 98.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 83.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 84.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 30.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 37.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 47.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 52.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 58.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 59.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 230.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 250.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 255.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 267.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 274.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 278.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 305.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 308.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 321.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 333.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 338.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 339.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 343.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 350.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 360.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 370.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 374.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 381.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 384.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 393.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 398.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 401.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 418.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 442.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 469.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 478.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 490.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 500.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 517.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 518.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 523.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 620.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 673.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 674.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 715.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 723.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 769.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 770.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 785.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 794.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 799.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 802.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 815.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 843.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 859.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 865.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 954.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 998.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1046.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1066.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1077.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1122.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1130.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1167.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1725.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1765.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1919.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1955.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 1989.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 2100.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 2941.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 3052.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 3167.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 3330.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 3456.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 3511.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | MAP kinase ERK2 | Delta TM | 0.01 | C | None |
| Homo sapiens | Peregrin | Delta TM | -1.97 | C | None |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | Delta TM | -0.34 | C | None |
| Homo sapiens | Transcription intermediary factor 1-alpha | Delta TM | -1.0 | C | None |
| Homo sapiens | Tyrosine-protein kinase ABL | Delta TM | 0.48 | C | None |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 39.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 71.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 87.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 89.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 90.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 32.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 39.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 48.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 52.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 33.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 43.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 54.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 92.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 99.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 139.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 149.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 156.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 178.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 199.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 255.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 276.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 361.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 732.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 8571.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 11828.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 14221.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 20657.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 20807.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 26450.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 31171.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 44507.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 64.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 69.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 91.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 92.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 93.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Growth Rate | -0.24 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | -0.2 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | -0.14 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | -0.09 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.07 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.09 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.12 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.29 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.37 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 43.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 59.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 69.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 71.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 72.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 72.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 74.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 75.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 76.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 76.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 78.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 85.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 88.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 90.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 91.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 92.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 93.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 30.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 31.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 37.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 38.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 39.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 40.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 41.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 30.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 31.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 33.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 36.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 43.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 43.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 47.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 48.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 49.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 55.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 63.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 63.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 72.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 89.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 38.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 38.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 42.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 44.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 46.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 23.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 26.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 84.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 86.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Normal (%) | 100.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 28.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 35.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 36.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 24.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 34.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 43.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 44.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 46.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 49.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 56.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 62.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 74.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 79.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 87.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 87.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 90.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 94.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 95.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 98.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 99.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 106.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 108.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 122.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 127.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 130.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 131.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 145.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 148.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 150.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 159.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 161.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 162.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 164.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 167.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 168.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 170.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 176.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 178.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 183.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 183.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 187.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 196.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 198.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 200.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 200.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 203.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 204.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 207.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 215.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 218.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 221.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 225.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 228.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 233.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 236.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 245.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 246.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 247.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 255.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 266.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 275.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 284.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 286.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 294.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 405.0 | None | 10.6019/CHEMBL4689842 |
| None | ADMET | Biotransformation | nan | None | 10.1038/s41586-019-1291-3 |