Bastadin 12
AlkaPlorer ID: AK318563
Synonym: None
IUPAC Name: (12Z,25Z,29S)-5,16,21,32,33-pentabromo-4,20,29-trihydroxy-12,25-bis(hydroxyimino)-2,18-dioxa-10,27-diazapentacyclo[28.2.2.214,17.13,7.119,23]octatriaconta-1(32),3,5,7(38),14,16,19,21,23(35),30,33,36-dodecaene-11,26-dione
Structure
SMILES: O/N=C1\CC2=CC=C(OC3=CC(=CC(Br)=C3O)C/C(=N\O)C(O)=NC[C@@H](O)C3=CC(Br)=C(OC4=CC(=CC(Br)=C4O)CCN=C1O)C(Br)=C3)C(Br)=C2
InChI: InChI=1S/C34H27Br5N4O9/c35-19-5-15-1-2-27(19)51-28-11-17(7-21(37)30(28)45)9-25(43-50)34(48)41-14-26(44)18-12-22(38)32(23(39)13-18)52-29-10-16(6-20(36)31(29)46)3-4-40-33(47)24(8-15)42-49/h1-2,5-7,10-13,26,44-46,49-50H,3-4,8-9,14H2,(H,40,47)(H,41,48)/b42-24+,43-25+/t26-/m1/s1
InChIKey: YUJCERKJBSZPJE-BMMWFESESA-N
Reference
A New Bastadin from the Sponge Psammaplysilla purpurea
PubChem CID: 44575628
LOTUS: LTS0033818
SuperNatural Ⅲ: SN0460532-06
NPASS: NPC141405
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Ianthella quadrangulata | Ianthella | Ianthellidae | Verongiida | Demospongiae | Porifera | Metazoa | Eukaryota |
| Ianthella basta | Ianthella | Ianthellidae | Verongiida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 1035.129
TPSA？: 209.51
MolLogP？: 9.442999999999998
Number of H-Donors: 7
Number of H-Acceptors: 11
RingCount: 8
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Candida albicans | Candida albicans | Activity | nan | None | 10.1021/np50119a005 |
| Cryptococcus neoformans | Cryptococcus neoformans | Activity | nan | None | 10.1021/np50119a005 |
| Enterococcus faecalis | Enterococcus faecalis | MIC | 50.0 | ug | 10.1021/np50119a005 |
| Escherichia coli | Escherichia coli | Activity | nan | None | 10.1021/np50119a005 |
| Homo sapiens | A498 | ED50 | 2.1 | ug ml-1 | 10.1021/np50119a005 |
| Homo sapiens | Acyl coenzyme A:cholesterol acyltransferase 1 | Inhibition | nan | % | 10.1016/j.bmcl.2015.09.024 |
| Homo sapiens | Acyl coenzyme A:cholesterol acyltransferase 2 | Inhibition | nan | % | 10.1016/j.bmcl.2015.09.024 |
| Homo sapiens | HUVEC | Activity | 27.6 | % | 10.1021/np070373e |
| Homo sapiens | KM-20L2 | ED50 | 2.1 | ug ml-1 | 10.1021/np50119a005 |
| Homo sapiens | NCI-H460 | ED50 | 2.3 | ug ml-1 | 10.1021/np50119a005 |
| Homo sapiens | OVCAR-3 | ED50 | 2.0 | ug ml-1 | 10.1021/np50119a005 |
| Homo sapiens | SF-295 | ED50 | 2.4 | ug ml-1 | 10.1021/np50119a005 |
| Homo sapiens | SK-MEL-5 | ED50 | 2.2 | ug ml-1 | 10.1021/np50119a005 |
| Mus musculus | P388 | ED50 | 9.1 | ug ml-1 | 10.1021/np50119a005 |
| Neisseria gonorrhoeae | Neisseria gonorrhoeae | Activity | nan | None | 10.1021/np50119a005 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 6.25 | ug | 10.1021/np50119a005 |
| None | ADMET | Activity | nan | None | 10.1016/j.bmcl.2015.09.024 |
| None | Unchecked | Inhibition | 80.0 | % | 10.1016/j.bmcl.2015.09.024 |