Myxotyroside A
AlkaPlorer ID: AK318981
Synonym: None
IUPAC Name: (Z)-15-methyl-N-[(Z)-2-[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]ethenyl]hexadec-2-enamide
Structure
SMILES: CC(C)CCCCCCCCCCC/C=C\C(O)=N/C=C\C1=CC=C(O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)C=C1
InChI: InChI=1S/C31H49NO6/c1-23(2)15-13-11-9-7-5-4-6-8-10-12-14-16-27(33)32-22-21-25-17-19-26(20-18-25)38-31-30(36)29(35)28(34)24(3)37-31/h14,16-24,28-31,34-36H,4-13,15H2,1-3H3,(H,32,33)/b16-14-,22-21-/t24-,28-,29+,30+,31-/m0/s1
InChIKey: OEUGFCRAXXFNAR-SRUKPRNUSA-N
Reference
Myxotyrosides A and B, Unusual Rhamnosides from <i>Myxococcus</i> sp.
PubChem CID: 25210012
LOTUS: LTS0048012
SuperNatural Ⅲ: SN0263506-02
NPASS: NPC195814
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Myxococcus sp. | Myxococcus | Myxococcaceae | Myxococcales | Myxococcia | Myxococcota | None | Bacteria |
Properties Information
Molecule Weight: 531.7340000000002
TPSA?: 111.74000000000002
MolLogP?: 6.32340000000001
Number of H-Donors: 4
Number of H-Acceptors: 6
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus ruber | Aspergillus ruber | Activity | nan | None | 10.1021/np8005875 |
| [Chlorella] fusca | [Chlorella] fusca | Activity | nan | None | 10.1021/np8005875 |
| Chromobacterium violaceum | Chromobacterium violaceum | Activity | nan | None | 10.1021/np8005875 |
| Escherichia coli | Escherichia coli | Activity | nan | None | 10.1021/np8005875 |
| Microbotryum violaceum | Microbotryum violaceum | Activity | nan | None | 10.1021/np8005875 |
| Mycotypha microspora | Mycotypha microspora | Activity | nan | None | 10.1021/np8005875 |
| Myxococcus xanthus DK 1622 | Myxococcus xanthus DK 1622 | Activity | nan | None | 10.1021/np8005875 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 7000.0 | nM | 10.1021/np8005875 |
| Priestia megaterium | Priestia megaterium | Activity | nan | None | 10.1021/np8005875 |
| Pseudomonas putida | Pseudomonas putida | Activity | nan | None | 10.1021/np8005875 |
