Cytochalasin D
AlkaPlorer ID: AK319352
Synonym: None
IUPAC Name: [(1R,2R,3E,5R,7S,9E,11R,12S,14S,15R,16S)-16-benzyl-5,12-dihydroxy-5,7,14-trimethyl-13-methylidene-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-2-yl] acetate
Structure
SMILES: C=C1[C@@H](C)[C@H]2[C@H](CC3=CC=CC=C3)N=C(O)[C@]23[C@H](OC(C)=O)/C=C/[C@@](C)(O)C(=O)[C@@H](C)C/C=C/[C@H]3[C@@H]1O
InChI: InChI=1S/C30H37NO6/c1-17-10-9-13-22-26(33)19(3)18(2)25-23(16-21-11-7-6-8-12-21)31-28(35)30(22,25)24(37-20(4)32)14-15-29(5,36)27(17)34/h6-9,11-15,17-18,22-26,33,36H,3,10,16H2,1-2,4-5H3,(H,31,35)/b13-9+,15-14+/t17-,18+,22-,23-,24+,25-,26+,29+,30+/m0/s1
InChIKey: SDZRWUKZFQQKKV-JHADDHBZSA-N
Reference
A new ten-membered lactone from Tubercularia sp. TF5, an endophytic fungus of Taxus mairei
PubChem CID: 5458428
LOTUS: LTS0180825
SuperNatural Ⅲ: SN0342897-21
NPASS: NPC239770
Source
Properties Information
Molecule Weight: 507.6270000000003
TPSA？: 116.42
MolLogP？: 3.757400000000004
Number of H-Donors: 3
Number of H-Acceptors: 6
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Balamuthia mandrillaris | Balamuthia mandrillaris | Inhibition | 13.0 | % | 10.1128/aac.00373-07 |
| Balamuthia mandrillaris | Balamuthia mandrillaris | Inhibition | 42.0 | % | 10.1128/aac.00373-07 |
| Balamuthia mandrillaris | Balamuthia mandrillaris | Inhibition | 64.0 | % | 10.1128/aac.00373-07 |
| Balamuthia mandrillaris | Balamuthia mandrillaris | Inhibition | 76.0 | % | 10.1128/aac.00373-07 |
| Electrophorus electricus | Acetylcholinesterase | Inhibition | -2.15 | % | 10.1016/j.bmc.2012.09.040 |
| Equus caballus | Cholinesterase | Inhibition | 3.92 | % | 10.1016/j.bmc.2012.09.040 |
| Homo sapiens | H4 | Activity | 71.84 | % | 10.1073/pnas.0709695104 |
| Homo sapiens | H4 | Activity | 258.44 | % | 10.1073/pnas.0709695104 |
| Homo sapiens | H4 | Activity | 306.27 | % | 10.1073/pnas.0709695104 |
| Homo sapiens | H4 | Activity | 378.77 | % | 10.1073/pnas.0709695104 |
| Homo sapiens | Jurkat | Activity | nan | None | 10.1016/j.bmc.2019.115145 |
| Homo sapiens | Ramos | Activity | nan | None | 10.1016/j.bmc.2019.115145 |
| Homo sapiens | SW-620 | FC | 4.0 | None | 10.1016/j.bmc.2019.115248 |
| Issatchenkia orientalis | ATP binding cassette transporter Abc1p | Activity | nan | None | 10.1128/aac.01095-08 |
| Mus musculus | Toll-like receptor 1/2 | Inhibition | nan | % | 10.1016/j.bmc.2018.07.013 |
| None | Bone marrow cell | Activity | nan | None | 10.1016/j.bmc.2019.115145 |
| None | Dendritic cell | FC | 2.0 | None | 10.1016/j.bmc.2019.115145 |
| None | Unchecked | Activity | nan | None | 10.1016/j.bmc.2008.06.032 |
| None | Unchecked | Activity | nan | None | 10.1016/j.bmc.2019.115145 |