Gs-39783
AlkaPlorer ID: AK319764
Synonym: None
IUPAC Name: 4-N,6-N-dicyclopentyl-2-methylsulfanyl-5-nitropyrimidine-4,6-diamine
Structure
SMILES: CSC1=NC(NC2CCCC2)=C([N+](=O)[O-])C(NC2CCCC2)=N1
InChI: InChI=1S/C15H23N5O2S/c1-23-15-18-13(16-10-6-2-3-7-10)12(20(21)22)14(19-15)17-11-8-4-5-9-11/h10-11H,2-9H2,1H3,(H2,16,17,18,19)
InChIKey: GSGVDKOCBKBMGG-UHFFFAOYSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Ephedra intermedia | Ephedra | Ephedraceae | Ephedrales | Gnetopsida | Streptophyta | Viridiplantae | Eukaryota |
| Ephedra sinica | Ephedra | Ephedraceae | Ephedrales | Gnetopsida | Streptophyta | Viridiplantae | Eukaryota |
| Ephedra equisetina | Ephedra | Ephedraceae | Ephedrales | Gnetopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 337.4490000000001
TPSA？: 92.98
MolLogP？: 3.8157000000000014
Number of H-Donors: 2
Number of H-Acceptors: 7
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus anthracis | Anthrax lethal factor | Potency | 10000.0 | nM | None |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Inhib (Mean) | -25.96 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Max (Mean) | 18.91 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Inhib (Mean) | -6.9 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Max (Mean) | 1.3 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Inhib (Mean) | -23.08 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Max (Mean) | 0.521 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Inhib (Mean) | -35.42 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Max (Mean) | -1.71 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Bromodomain-containing protein 4 | Delta TM | -2.58 | C | None |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Inhib (Mean) | 27.58 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Max (Mean) | -0.6894 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Casein kinase I delta | Delta TM | 0.0 | C | None |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Inhib (Mean) | -32.01 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Max (Mean) | -2.204 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Cyclin-dependent kinase 2 | Delta TM | 0.31 | C | None |
| Homo sapiens | Cytochrome P450 1A2 | AC50 | 3981.07 | nM | None |
| Homo sapiens | Cytochrome P450 2C19 | AC50 | 5011.87 | nM | None |
| Homo sapiens | Cytochrome P450 2C19 | Potency | 5011.9 | nM | None |
| Homo sapiens | Cytochrome P450 2C9 | AC50 | 1995.26 | nM | None |
| Homo sapiens | Cytochrome P450 2C9 | Potency | 1995.3 | nM | None |
| Homo sapiens | Cytochrome P450 2D6 | AC50 | nan | None | None |
| Homo sapiens | Cytochrome P450 3A4 | AC50 | nan | None | None |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 53.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 55.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 14985.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 15057.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 15078.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 15171.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 16285.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 16485.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 16657.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 17835.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Growth Rate | -0.14 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | 0.18 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | 0.19 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | 0.69 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | 0.9 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 36.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 39.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 54.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 58.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 59.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 31.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 44.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 48.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 57.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 45.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 69.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 73.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 39.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 57.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 121.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 129.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 132.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 133.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 134.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 135.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 137.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 153.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 162.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 164.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 165.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 168.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 172.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 184.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 185.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast | Total Cell Count | 193.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Fibroblast growth factor receptor 3 | Delta TM | 0.11 | C | None |
| Homo sapiens | GABA-B receptor | Activity | 192.0 | % | 10.1021/jm5018913 |
| Homo sapiens | GABA-B receptor | EC50 | 741.31 | nM | 10.1016/j.bmcl.2007.09.023 |
| Homo sapiens | GABA-B receptor | Efficacy | 132.0 | % | 10.1016/j.bmcl.2007.09.023 |
| Homo sapiens | GABA-B receptor | Efficacy | 153.0 | % | 10.1016/j.bmcl.2007.09.023 |
| Homo sapiens | GABA-B receptor | Emax | 146.0 | % | 10.1016/j.bmcl.2007.09.023 |
| Homo sapiens | GABA-B receptor 1 | Activity | 0.0 | % | 10.1016/j.bmcl.2017.03.084 |
| Homo sapiens | GABA-B receptor 1 | EC50 | 79.43 | nM | 10.1016/j.bmcl.2017.03.084 |
| Homo sapiens | GABA-B receptor 1 | %max | 90.4 | % | 10.1016/j.bmcl.2017.03.084 |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Inhib (Mean) | -38.08 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Max (Mean) | 0.41 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Inhib (Mean) | 0.07985 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Max (Mean) | 5.213 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glycogen synthase kinase-3 beta | Delta TM | -0.59 | C | None |
| Homo sapiens | G-protein coupled receptor 120 | %Inhib (Mean) | -59.2 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 120 | %Max (Mean) | -0.8 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 35 | %Inhib (Mean) | -30.56 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 35 | %Max (Mean) | 16.6 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 61.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 79.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 36.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 59.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 83.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 55.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 77.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 45.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 22878.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 29842.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 35035.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 45150.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 45535.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 60692.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 68271.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 101135.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 20.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Growth Rate | 0.5 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | 0.78 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | 0.85 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | 0.92 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | 0.97 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 37.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 45.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 47.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 59.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 37.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 59.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 35.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 50.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 57.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 86.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 54.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 59.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 69.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 81.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 34.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 41.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 51.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 201.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 235.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 265.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 301.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 308.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 346.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 360.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 406.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 449.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 474.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 492.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 505.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 553.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 647.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 775.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | HEK-293T | Total Cell Count | 856.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -47.7 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -5.72 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Lipoxin A4 receptor | %Inhib (Mean) | -13.48 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Lipoxin A4 receptor | %Max (Mean) | -3.04 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | MAP kinase ERK2 | Delta TM | 0.18 | C | None |
| Homo sapiens | Menin/Histone-lysine N-methyltransferase MLL | Potency | 39810.7 | nM | None |
| Homo sapiens | Peregrin | Delta TM | -2.5 | C | None |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | Delta TM | -0.21 | C | None |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Inhib (Mean) | -13.5 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Max (Mean) | 2.079 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Transcription intermediary factor 1-alpha | Delta TM | -2.77 | C | None |
| Homo sapiens | Type-1 angiotensin II receptor | %Inhib (Mean) | -20.47 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Type-1 angiotensin II receptor | %Max (Mean) | -2.359 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Tyrosine-protein kinase ABL | Delta TM | 0.0 | C | None |
| Homo sapiens | Tyrosyl-DNA phosphodiesterase 1 | Potency | 891.3 | nM | None |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 33.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 71.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 8571.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 11828.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 14221.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 20657.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 20807.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 26450.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 31171.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 44507.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Growth Rate | -1.0 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.05 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.75 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.83 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.92 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 72.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 80.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 81.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 82.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 83.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 84.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 85.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 87.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 88.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 89.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 92.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 23.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 26.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 30.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 40.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 52.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 61.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 63.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 71.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 14.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 15.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 17.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 18.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 20.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 27.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Normal (%) | 100.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 71.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 96.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 97.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 119.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 145.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 154.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 164.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 185.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 209.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 231.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 255.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 269.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 322.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 341.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 382.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | U2OS | Total Cell Count | 462.0 | None | 10.6019/CHEMBL5058577 |
| Homo sapiens | Ubiquitin carboxyl-terminal hydrolase 1 | Potency | 15848.9 | nM | None |
| Mus musculus | Mus musculus | Activity | nan | None | 10.1021/jm400144w |
| Mus musculus | Mus musculus | TIME | 0.0 | hr | 10.1021/jm400144w |
| Mus musculus | Mus musculus | TIME | 0.03833 | hr | 10.1021/jm400144w |
| Mus musculus | Mus musculus | TIME | 0.955 | hr | 10.1021/jm400144w |
| Mus musculus | Mus musculus | TIME | 1.0 | hr | 10.1021/jm400144w |
| Mus musculus | NIH3T3 | IC50 | 60000.0 | nM | 10.1021/jm400144w |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | -1.12 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 21.48 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | -0.1 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.02 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 25.87 | % | 10.21203/rs.3.rs-23951/v1 |
| None | Unchecked | Activity | 59.0 | % | 10.1021/jm400144w |
| None | Unchecked | Potency | 11220.2 | nM | None |