Sid11111800
AlkaPlorer ID: AK322165
Synonym: None
IUPAC Name: 3-(3-chloro-4-hydroxyanilino)-4-(2-nitrophenyl)pyrrole-2,5-dione
Structure
SMILES: O=C1N=C(O)C(C2=CC=CC=C2[N+](=O)[O-])=C1NC1=CC=C(O)C(Cl)=C1
InChI: InChI=1S/C16H10ClN3O5/c17-10-7-8(5-6-12(10)21)18-14-13(15(22)19-16(14)23)9-3-1-2-4-11(9)20(24)25/h1-7,21H,(H2,18,19,22,23)
InChIKey: PQCXVIPXISBFPN-UHFFFAOYSA-N
Reference
Eutypoids B−E Produced by a <i>Penicillium</i> sp. Strain from the North Sea
PubChem CID: 4210951
CAS: 264218-23-7
LOTUS: LTS0072168
NPASS: NPC471785
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Penicillium sp. | Penicillium | Aspergillaceae | Eurotiales | Eurotiomycetes | Ascomycota | Fungi | Eukaryota |
Properties Information
Molecule Weight: 359.725
TPSA？: 125.06
MolLogP？: 3.2737000000000016
Number of H-Donors: 3
Number of H-Acceptors: 5
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | 4'-phosphopantetheinyl transferase ffp | Potency | 39810.7 | nM | None |
| Bacillus subtilis | 4'-phosphopantetheinyl transferase ffp | Potency | 56234.1 | nM | None |
| Equus caballus | Ferritin light chain | Potency | 19952.6 | nM | None |
| Gallus gallus | Tyrosine-protein kinase SRC | Activity | 77.0 | % | 10.1042/bj20070797 |
| Giardia intestinalis | Putative fructose-1,6-bisphosphate aldolase | Potency | 25118.9 | nM | None |
| Giardia intestinalis | Putative fructose-1,6-bisphosphate aldolase | Potency | 28117.1 | nM | None |
| Giardia intestinalis | Putative fructose-1,6-bisphosphate aldolase | Potency | 35481.3 | nM | None |
| Homo sapiens | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Potency | 7079.5 | nM | None |
| Homo sapiens | 3-phosphoinositide dependent protein kinase-1 | Activity | 62.0 | % | 10.1042/bj20070797 |
| Homo sapiens | 3-phosphoinositide dependent protein kinase-1 | Inhibition | 8.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Inhib (Mean) | 17.27 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Inhib (Mean) | 17.8 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Inhib (Mean) | 22.85 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Inhib (Mean) | 41.76 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Max (Mean) | 7.877 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Aldehyde dehydrogenase 1A1 | Potency | 28183.8 | nM | None |
| Homo sapiens | Alpha-2a adrenergic receptor | %Inhib (Mean) | -20.1 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Inhib (Mean) | -11.38 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Inhib (Mean) | 2.5 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Inhib (Mean) | 14.26 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Max (Mean) | 2.0 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Inhib (Mean) | -50.43 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Inhib (Mean) | -35.46 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Inhib (Mean) | 12.48 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Inhib (Mean) | 18.01 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Max (Mean) | 1.511 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | ATPase family AAA domain-containing protein 5 | Potency | 7.3 | nM | None |
| Homo sapiens | ATPase family AAA domain-containing protein 5 | Potency | 919.6 | nM | None |
| Homo sapiens | Beta-2 adrenergic receptor | %Inhib (Mean) | -57.95 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Inhib (Mean) | -20.24 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Inhib (Mean) | -10.76 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Inhib (Mean) | 16.77 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Max (Mean) | -2.25 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-glucocerebrosidase | Potency | 17782.8 | nM | None |
| Homo sapiens | Bloom syndrome protein | Potency | 12589.3 | nM | None |
| Homo sapiens | Bromodomain adjacent to zinc finger domain protein 2B | Potency | 50118.7 | nM | None |
| Homo sapiens | Bromodomain-containing protein 4 | Delta TM | -1.2 | C | None |
| Homo sapiens | BR serine/threonine-protein kinase 2 | Activity | 38.0 | % | 10.1042/bj20070797 |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Inhib (Mean) | -1.33 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Inhib (Mean) | -0.5938 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Inhib (Mean) | 14.81 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Inhib (Mean) | 31.36 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Max (Mean) | -4.628 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | CaM kinase I alpha | Activity | 61.0 | % | 10.1042/bj20070797 |
| Homo sapiens | CaM-kinase kinase alpha | Activity | 53.0 | % | 10.1042/bj20070797 |
| Homo sapiens | CaM-kinase kinase beta | Activity | 29.0 | % | 10.1042/bj20070797 |
| Homo sapiens | cAMP-dependent protein kinase alpha-catalytic subunit | Activity | 80.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Casein kinase I delta | Activity | 68.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Casein kinase I delta | Delta TM | 1.06 | C | None |
| Homo sapiens | Casein kinase II | Activity | 97.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Casein kinase II | Inhibition | 18.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Chromobox protein homolog 1 | Potency | 35481.3 | nM | None |
| Homo sapiens | c-Jun N-terminal kinase 1 | Activity | 96.0 | % | 10.1042/bj20070797 |
| Homo sapiens | c-Jun N-terminal kinase 2 | Activity | 88.0 | % | 10.1042/bj20070797 |
| Homo sapiens | c-Jun N-terminal kinase 3 | Activity | 90.0 | % | 10.1042/bj20070797 |
| Homo sapiens | c-Jun N-terminal kinase, JNK | Inhibition | 0.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Inhib (Mean) | -14.04 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Inhib (Mean) | -8.36 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Inhib (Mean) | 2.74 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Inhib (Mean) | 11.6 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Max (Mean) | -0.7762 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Cyclin-dependent kinase 1/cyclin B | IC50 | 900.0 | nM | 10.1016/j.tips.2004.07.006 |
| Homo sapiens | Cyclin-dependent kinase 2 | Delta TM | 3.81 | C | None |
| Homo sapiens | Cyclin-dependent kinase 2/cyclin A | Activity | 18.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Cyclin-dependent kinase 2/cyclin A | IC50 | 380.0 | nM | 10.1021/jm021095d |
| Homo sapiens | Cyclin-dependent kinase 2/cyclin A | IC50 | nan | nM | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Cyclin-dependent kinase 5/CDK5 activator 1 | AC50 | 5559.0 | nM | None |
| Homo sapiens | Cytochrome P450 1A2 | AC50 | 31622.78 | nM | None |
| Homo sapiens | Cytochrome P450 2C19 | AC50 | nan | None | None |
| Homo sapiens | Cytochrome P450 2C19 | Potency | 39810.7 | nM | None |
| Homo sapiens | Cytochrome P450 2C9 | AC50 | nan | None | None |
| Homo sapiens | Cytochrome P450 2C9 | Potency | 31622.8 | nM | None |
| Homo sapiens | Cytochrome P450 2D6 | AC50 | nan | None | None |
| Homo sapiens | Cytochrome P450 3A4 | AC50 | 19952.62 | nM | None |
| Homo sapiens | Cytochrome P450 3A4 | Potency | 12589.3 | nM | None |
| Homo sapiens | DNA-(apurinic or apyrimidinic site) lyase | Potency | 44668.4 | nM | None |
| Homo sapiens | DNA polymerase beta | Potency | 11220.2 | nM | None |
| Homo sapiens | DNA polymerase beta | Potency | 14125.4 | nM | None |
| Homo sapiens | DNA polymerase eta | Potency | 19952.6 | nM | None |
| Homo sapiens | DNA polymerase iota | Potency | 28183.8 | nM | None |
| Homo sapiens | DNA polymerase kappa | Potency | 2818.4 | nM | None |
| Homo sapiens | DNA polymerase kappa | Potency | 11220.2 | nM | None |
| Homo sapiens | DNA polymerase kappa | Potency | 37685.8 | nM | None |
| Homo sapiens | Dopamine D1 receptor | Potency | 46.1 | nM | None |
| Homo sapiens | Dopamine D1 receptor | Potency | 5173.2 | nM | None |
| Homo sapiens | Dual specificity mitogen-activated protein kinase kinase 1 | Activity | 28.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Dual specificity mitogen-activated protein kinase kinase 1 | Inhibition | 12.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Activity | 30.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Activity | 83.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Activity | 84.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Potency | 199.5 | nM | None |
| Homo sapiens | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Potency | 3162.3 | nM | None |
| Homo sapiens | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Potency | 12589.3 | nM | None |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 72.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 37.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 59.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 127.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 131.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 198.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 199.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 205.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 208.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 212.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 216.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Growth Rate | -0.16 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Growth Rate | 0.11 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 33.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 35.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 37.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 45.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 46.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 47.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 52.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 53.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 75.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 63.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 91.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 52.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 53.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 54.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 87.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Normal (%) | 100.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 120.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 127.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 136.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 150.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 157.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 162.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 163.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 165.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 172.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 191.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 210.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 215.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 216.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 217.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 220.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast | Total Cell Count | 235.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Fibroblast growth factor receptor 3 | Delta TM | 1.81 | C | None |
| Homo sapiens | Flap endonuclease 1 | Potency | 18887.6 | nM | None |
| Homo sapiens | Geminin | Potency | 15848.9 | nM | None |
| Homo sapiens | Geminin | Potency | 29092.9 | nM | None |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Inhib (Mean) | -39.68 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Inhib (Mean) | -25.49 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Inhib (Mean) | -2.36 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Inhib (Mean) | 0.67 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Max (Mean) | -0.13 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Inhib (Mean) | -46.36 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Inhib (Mean) | -33.51 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Inhib (Mean) | -17.66 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Inhib (Mean) | 2.25 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Max (Mean) | 7.086 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glutaminase kidney isoform, mitochondrial | Potency | 10000.0 | nM | None |
| Homo sapiens | Glycogen synthase kinase-3 | IC50 | 130.0 | nM | 10.1016/j.tips.2004.07.006 |
| Homo sapiens | Glycogen synthase kinase-3 alpha | Control | 1.5 | % | 10.1016/j.bmcl.2004.09.013 |
| Homo sapiens | Glycogen synthase kinase-3 alpha | IC50 | 78.0 | nM | 10.1016/j.tips.2004.07.006 |
| Homo sapiens | Glycogen synthase kinase-3 alpha | IC50 | 104.0 | nM | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Glycogen synthase kinase-3 beta | Activity | 4.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Glycogen synthase kinase-3 beta | Delta TM | 8.85 | C | None |
| Homo sapiens | Glycogen synthase kinase-3 beta | EC50 | 30620.0 | nM | 10.1021/jm021095d |
| Homo sapiens | Glycogen synthase kinase-3 beta | EC50 | 45600.0 | nM | 10.1021/jm021095d |
| Homo sapiens | Glycogen synthase kinase-3 beta | Fold stimulation | 1.3 | None | 10.1021/jm021095d |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 34.0 | nM | 10.1021/acs.jmedchem.0c00931 |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 50.0 | nM | 10.1021/acsmedchemlett.8b00507 |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 54.0 | nM | 10.1016/j.ejmech.2021.113554 |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 77.0 | nM | 10.1016/j.bmcl.2010.01.038 |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 78.0 | nM | 10.1016/j.ejmech.2008.08.012 |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 90.0 | nM | 10.1021/np100633k |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 104.0 | nM | 10.1021/jm7009765 |
| Homo sapiens | Glycogen synthase kinase-3 beta | IC50 | 380.0 | nM | 10.1021/jm021095d |
| Homo sapiens | Glycogen synthase kinase-3 beta | Inhibition | 83.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Glycogen synthase kinase-3 beta | Inhibition | 99.4 | % | 10.1016/j.ejmech.2021.113554 |
| Homo sapiens | Glycogen synthase kinase-3 beta | Ki | 24.0 | nM | 10.1016/j.bmcl.2010.01.072 |
| Homo sapiens | G-protein coupled receptor 120 | %Inhib (Mean) | -54.1 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 120 | %Inhib (Mean) | -27.62 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 120 | %Inhib (Mean) | 2.14 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 120 | %Inhib (Mean) | 46.14 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 120 | %Max (Mean) | 0.6 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 35 | %Inhib (Mean) | 4.4 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 35 | %Max (Mean) | 12.88 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Guanine nucleotide-binding protein G(s), subunit alpha | Potency | 2511.9 | nM | None |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 54.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 57.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 85.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 364.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 370.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 680.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 681.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 1046.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 1069.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 2439.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 2812.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 47.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 48.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Growth Rate | 0.13 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Growth Rate | 0.17 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 15.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 19.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 26.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 28.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 32.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 34.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 36.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 37.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 41.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 45.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 87.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 88.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 89.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 54.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 58.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 59.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 67.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 71.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 80.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 84.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 85.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 88.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 97.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 30.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 34.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 227.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 316.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 319.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 339.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 496.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 574.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 670.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 694.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 721.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 894.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 1015.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 1100.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 1557.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 1997.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 2547.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HEK-293T | Total Cell Count | 2762.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | HepG2 | Potency | 35481.3 | nM | None |
| Homo sapiens | Histone acetyltransferase GCN5 | Potency | 28183.8 | nM | None |
| Homo sapiens | Histone deacetylase 1 | IC50 | nan | None | 10.1021/acsmedchemlett.8b00507 |
| Homo sapiens | Histone deacetylase 6 | IC50 | nan | None | 10.1021/acsmedchemlett.8b00507 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 3.31 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 3.99 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Potency | 1500.3 | nM | None |
| Homo sapiens | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Potency | 2238.7 | nM | None |
| Homo sapiens | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Potency | 3548.1 | nM | None |
| Homo sapiens | Homeodomain-interacting protein kinase 2 | Activity | 63.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Homeodomain-interacting protein kinase 3 | Activity | 85.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Hypoxia-inducible factor 1 alpha | Potency | 12589.3 | nM | None |
| Homo sapiens | Inhibitor of nuclear factor kappa B kinase beta subunit | Activity | 84.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Lipoxin A4 receptor | %Inhib (Mean) | -41.01 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Lipoxin A4 receptor | %Inhib (Mean) | -36.22 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Lipoxin A4 receptor | %Inhib (Mean) | -8.28 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Lipoxin A4 receptor | %Inhib (Mean) | 2.95 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Lipoxin A4 receptor | %Max (Mean) | -2.92 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Lysine-specific demethylase 4A | Potency | 79432.8 | nM | None |
| Homo sapiens | Lysosomal alpha-glucosidase | Potency | 22387.2 | nM | None |
| Homo sapiens | MAP kinase-activated protein kinase 2 | Activity | 85.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase-activated protein kinase 2 | Inhibition | 4.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | MAP kinase-activated protein kinase 3 | Activity | 99.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase-activated protein kinase 5 | Activity | 81.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase-activated protein kinase 5 | Inhibition | 0.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | MAP kinase ERK1 | Activity | 94.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase ERK2 | Activity | 96.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase ERK2 | Delta TM | 0.54 | C | None |
| Homo sapiens | MAP kinase ERK2 | Potency | 6309.6 | nM | None |
| Homo sapiens | MAP kinase-interacting serine/threonine-protein kinase MNK1 | Activity | 77.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase p38 alpha | Activity | 72.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase p38 alpha | Inhibition | 5.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | MAP kinase p38 beta | Activity | 89.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase p38 beta | Inhibition | 0.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | MAP kinase p38 delta | Activity | 82.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase p38 delta | Inhibition | 0.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | MAP kinase p38 gamma | Activity | 98.0 | % | 10.1042/bj20070797 |
| Homo sapiens | MAP kinase p38 gamma | Inhibition | 0.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | MAP kinase signal-integrating kinase 2 | Activity | 91.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Maternal embryonic leucine zipper kinase | Activity | 72.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Menin/Histone-lysine N-methyltransferase MLL | Potency | 31622.8 | nM | None |
| Homo sapiens | Microtubule-associated protein tau | Potency | 7943.3 | nM | None |
| Homo sapiens | Microtubule-associated protein tau | Potency | 12589.3 | nM | None |
| Homo sapiens | Microtubule-associated protein tau | Potency | 14125.4 | nM | None |
| Homo sapiens | Microtubule-associated protein tau | Potency | 15848.9 | nM | None |
| Homo sapiens | Microtubule-associated protein tau | Potency | 31622.8 | nM | None |
| Homo sapiens | Mitogen-activated protein kinase 15 | Activity | 13.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Mitogen-activated protein kinase; ERK1/ERK2 | Inhibition | 3.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Mothers against decapentaplegic homolog 3 | Potency | 12589.3 | nM | None |
| Homo sapiens | M-phase phosphoprotein 8 | Potency | 23778.1 | nM | None |
| Homo sapiens | M-phase phosphoprotein 8 | Potency | 56234.1 | nM | None |
| Homo sapiens | Muscleblind-like protein 1 | Potency | 15848.9 | nM | None |
| Homo sapiens | Muscleblind-like protein 1 | Potency | 22387.2 | nM | None |
| Homo sapiens | Myosin light chain kinase, smooth muscle | Activity | 65.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Nuclear factor NF-kappa-B p105 subunit | Potency | 6309.6 | nM | None |
| Homo sapiens | Peregrin | Delta TM | -2.63 | C | None |
| Homo sapiens | Peripheral myelin protein 22 | Potency | 60119.8 | nM | None |
| Homo sapiens | Prelamin-A/C | Potency | 354.8 | nM | None |
| Homo sapiens | Protein kinase C alpha | Activity | 39.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Protein kinase C alpha | Inhibition | 30.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Protein kinase C mu | Activity | 64.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Protein kinase C zeta | Activity | 69.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Protein kinase N2 | Activity | 43.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Regulator of G-protein signaling 4 | Potency | 11917.3 | nM | None |
| Homo sapiens | Rho-associated protein kinase 2 | Activity | 79.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Rho-associated protein kinase 2 | Inhibition | 0.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Ribosomal protein S6 kinase 1 | Activity | 81.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Ribosomal protein S6 kinase 1 | Inhibition | 8.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Ribosomal protein S6 kinase 2 | Inhibition | 62.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Ribosomal protein S6 kinase alpha 1 | Activity | 31.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Ribosomal protein S6 kinase alpha 3 | Activity | 29.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Ribosomal protein S6 kinase alpha 5 | Activity | 62.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Ribosomal protein S6 kinase alpha 5 | Inhibition | 19.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Runt-related transcription factor 1/Core-binding factor subunit beta | Potency | 35481.3 | nM | None |
| Homo sapiens | Serine/threonine-protein kinase AKT | Activity | 92.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase AKT2 | Activity | 85.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase AKT2 | Inhibition | 5.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | Delta TM | 1.35 | C | None |
| Homo sapiens | Serine/threonine-protein kinase Aurora-B | Activity | 64.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase Aurora-C | Activity | 70.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase Chk1 | Activity | 60.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase Chk1 | Inhibition | 25.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Serine/threonine-protein kinase Chk2 | Activity | 69.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase c-TAK1 | Activity | 29.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase EEF2K | Activity | 94.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase MST2 | Activity | 14.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase NEK2 | Activity | 86.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase NEK6 | Activity | 74.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase NEK7 | Activity | 86.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase PAK 4 | Activity | 52.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase PAK6 | Activity | 74.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase PAK7 | Activity | 67.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase PIM1 | Activity | 37.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase PIM2 | Activity | 46.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase PIM3 | Activity | 46.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase PLK1 | Activity | 85.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase Sgk1 | Activity | 82.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Serine/threonine-protein kinase Sgk1 | Inhibition | 3.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Serine/threonine-protein kinase SRPK1 | Activity | 54.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Inhib (Mean) | -21.07 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Inhib (Mean) | -8.8 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Inhib (Mean) | -3.17 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Inhib (Mean) | 0.94 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Max (Mean) | -3.863 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Survival motor neuron protein | Potency | 17782.8 | nM | None |
| Homo sapiens | Survival motor neuron protein | Potency | 35481.3 | nM | None |
| Homo sapiens | Thrombopoietin | Potency | 199.5 | nM | None |
| Homo sapiens | Thyroid stimulating hormone receptor | Potency | 39.8 | nM | None |
| Homo sapiens | Transcription intermediary factor 1-alpha | Delta TM | -0.54 | C | None |
| Homo sapiens | Type-1 angiotensin II receptor | %Inhib (Mean) | -30.59 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Type-1 angiotensin II receptor | %Inhib (Mean) | 2.82 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Type-1 angiotensin II receptor | %Inhib (Mean) | 19.53 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Type-1 angiotensin II receptor | %Inhib (Mean) | 22.66 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Type-1 angiotensin II receptor | %Max (Mean) | -3.134 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Tyrosine-protein kinase ABL | Delta TM | 0.4 | C | None |
| Homo sapiens | Tyrosine-protein kinase CSK | Activity | 89.0 | % | 10.1042/bj20070797 |
| Homo sapiens | Tyrosine-protein kinase LCK | Inhibition | 19.0 | % | 10.1016/s0960-894x(00)00721-6 |
| Homo sapiens | Tyrosyl-DNA phosphodiesterase 1 | Potency | 3264.3 | nM | None |
| Homo sapiens | Tyrosyl-DNA phosphodiesterase 1 | Potency | 7307.8 | nM | None |
| Homo sapiens | Tyrosyl-DNA phosphodiesterase 1 | Potency | 25118.9 | nM | None |
| Homo sapiens | Tyrosyl-DNA phosphodiesterase 1 | Potency | 26608.6 | nM | None |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 39.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 87.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 89.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 90.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 32.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 39.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 42.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 48.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 52.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 33.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 43.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 54.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 92.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 149.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 255.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 361.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 732.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 64.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 69.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 70.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 91.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 92.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 93.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Growth Rate | -1.0 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.02 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.84 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Growth Rate | 0.95 | None | 10.6019/CHEMBL5058564 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 27.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 31.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 37.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 55.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 71.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 75.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 80.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 37.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 50.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 90.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 91.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 20.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 44.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 77.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 100.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Normal (%) | 99.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Normal (%) | 100.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 73.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 84.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 85.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 86.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 90.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 92.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 93.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 95.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 98.0 | % | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 16.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 22.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 25.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 26.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 34.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 54.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 66.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 129.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 145.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 230.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 253.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 310.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 379.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 668.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | U2OS | Total Cell Count | 802.0 | None | 10.6019/CHEMBL5303300 |
| Homo sapiens | Vitamin D receptor | Potency | 44668.4 | nM | None |
| Influenza A virus | Nonstructural protein 1 | Potency | 35481.3 | nM | None |
| Mus musculus | Nuclear receptor ROR-gamma | Potency | 12589.3 | nM | None |
| Mus musculus | Nuclear receptor ROR-gamma | Potency | 25118.9 | nM | None |
| Mus musculus | Tyrosine-protein kinase LCK | Activity | 66.0 | % | 10.1042/bj20070797 |
| Mycobacterium tuberculosis | Acyl-CoA synthase | AC50 | 89100.0 | nM | None |
| Oryctolagus cuniculus | Fructose-bisphosphate aldolase A | Potency | 125892.5 | nM | None |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 501.19 | nM | 10.1038/nchembio.215 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 10000.0 | nM | 10.1038/nchembio.215 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 12589.25 | nM | 10.1038/nchembio.215 |
| Plasmodium falciparum | Plasmodium falciparum | Potency | 4147.5 | nM | None |
| Plasmodium falciparum | Plasmodium falciparum | Potency | 14715.7 | nM | None |
| Rattus norvegicus | Dual specificity tyrosine-phosphorylation-regulated kinase 1A | AC50 | 3106.0 | nM | None |
| Rattus norvegicus | Dual specificity tyrosine-phosphorylation-regulated kinase 1A | Inhibition | nan | % | 10.1016/j.ejmech.2021.113554 |
| Rattus norvegicus | Inositol monophosphatase 1 | Potency | 19952.6 | nM | None |
| Rattus norvegicus | Muscarinic acetylcholine receptor M1 | Potency | 17782.8 | nM | None |
| Rattus norvegicus | Thioredoxin reductase 1, cytoplasmic | Potency | 2667.9 | nM | None |
| Rattus norvegicus | Thioredoxin reductase 1, cytoplasmic | Potency | 23778.1 | nM | None |
| Schistosoma mansoni | Thioredoxin glutathione reductase | Potency | 7079.5 | nM | None |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | -1.514 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 18.61 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | -4.75 | % | 10.21203/rs.3.rs-23951/v1 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | -0.11 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.47 | % | 10.6019/CHEMBL4495565 |
| Simian virus 40 | Large T antigen | IC50 | 55430.0 | nM | None |
| Trypanosoma brucei | 6-phospho-1-fructokinase | Potency | 95.3 | nM | None |
| Trypanosoma brucei | Trypanosoma brucei | EC50 | 740.0 | nM | 10.1128/aac.00364-08 |
| None | NON-PROTEIN TARGET | Potency | 1.1 | nM | None |
| None | NON-PROTEIN TARGET | Potency | 5.3 | nM | None |
| None | NON-PROTEIN TARGET | Potency | 501.2 | nM | None |
| None | NON-PROTEIN TARGET | Potency | 9432.9 | nM | None |
| None | NON-PROTEIN TARGET | Potency | 11220.2 | nM | None |
| None | NON-PROTEIN TARGET | Potency | 11875.4 | nM | None |
| None | NON-PROTEIN TARGET | Potency | 12589.3 | nM | None |
| None | NON-PROTEIN TARGET | Potency | 17782.8 | nM | None |
| None | Unchecked | Activity | 33.0 | % | 10.1042/bj20070797 |
| None | Unchecked | Activity | 84.0 | % | 10.1042/bj20070797 |
| None | Unchecked | Control | 4.6 | % | 10.1016/j.bmcl.2004.09.013 |
| None | Unchecked | IC50 | 250.0 | nM | 10.1016/j.ejmech.2020.112915 |
| None | Unchecked | IC50 | 1000.0 | nM | 10.1128/aac.00364-08 |
| None | Unchecked | IC50 | 11750.0 | nM | None |
| None | Unchecked | IC50 | 100000.0 | nM | None |
| None | Unchecked | Inhibition | 0.0 | % | 10.1016/s0960-894x(00)00721-6 |
| None | Unchecked | Inhibition | 7.0 | % | 10.1016/s0960-894x(00)00721-6 |
| None | Unchecked | Inhibition | 46.0 | % | 10.1016/s0960-894x(00)00721-6 |
| None | Unchecked | Inhibition | nan | % | 10.1038/nchembio873 |
| None | Unchecked | Potency | 6309.6 | nM | None |
| None | Unchecked | Potency | 11220.2 | nM | None |
| None | Unchecked | Potency | 15848.9 | nM | None |
| None | Unchecked | Potency | 17782.8 | nM | None |