None
AlkaPlorer ID: AK322883
Synonym: None
IUPAC Name: None
Structure
SMILES: CC[C@H](C)[C@H](N=C(O)CN)C(O)=N[C@@H](CCSC)C(O)=N[C@@H](CO)C(O)=N[C@@H](CO)C(O)=N[C@@H](CC(C)C)C(O)=N[C@@H](CCSC)C(O)=N[C@@H](CCCCN)C(O)=N[C@@H](CCCCN)C(O)=N[C@@H](CC(C)C)C(O)=N[C@@H](C)C(O)=N[C@@H](C)C(O)=N[C@@H](CC1=CN=CN1)C(O)=N[C@H](C(O)=N[C@@H](CCCCN)C(O)=N[C@@H](CCCCN)C(=N)O)[C@@H](C)CC
InChI: InChI=1S/C78H143N23O18S2/c1-13-45(7)62(100-61(104)38-83)77(118)94-55(28-34-121-12)71(112)98-60(41-103)76(117)99-59(40-102)75(116)97-57(36-44(5)6)73(114)92-54(27-33-120-11)70(111)91-51(24-16-20-30-80)68(109)90-52(25-17-21-31-81)69(110)96-56(35-43(3)4)72(113)88-47(9)65(106)87-48(10)66(107)95-58(37-49-39-85-42-86-49)74(115)101-63(46(8)14-2)78(119)93-53(26-18-22-32-82)67(108)89-50(64(84)105)23-15-19-29-79/h39,42-48,50-60,62-63,102-103H,13-38,40-41,79-83H2,1-12H3,(H2,84,105)(H,85,86)(H,87,106)(H,88,113)(H,89,108)(H,90,109)(H,91,111)(H,92,114)(H,93,119)(H,94,118)(H,95,107)(H,96,110)(H,97,116)(H,98,112)(H,99,117)(H,100,104)(H,101,115)/t45-,46-,47-,48-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,62-,63-/m0/s1
InChIKey: BEZBLGIPGRUTFF-HMUKDCGDSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Hylaeus signatus | Hylaeus | Colletidae | Hymenoptera | Insecta | Arthropoda | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 1755.2789999999998
TPSA？: 732.1700000000002
MolLogP？: 8.553669999999993
Number of H-Donors: 25
Number of H-Acceptors: 26
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | MIC | 7000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Candida albicans | Candida albicans | MIC | 5000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Escherichia coli | Escherichia coli | MIC | 20000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Micrococcus luteus | Micrococcus luteus | MIC | 3000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 23000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 46000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 77000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 85000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 90000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | 11000.0 | nM | 10.1021/acs.jnatprod.5b01129 |
| None | Erythrocyte | LC50 | 400000.0 | nM | 10.1021/acs.jnatprod.5b01129 |