None
AlkaPlorer ID: AK323754
Synonym: None
IUPAC Name: (3Z)-N-(3-chlorophenyl)-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide
Structure
SMILES: CC1=C(C(=O)N2CCN(C)CC2)C(C)=C(/C=C2\C(O)=NC3=CC=C(S(=O)(=O)N(C)C4=CC=CC(Cl)=C4)C=C23)N1
InChI: InChI=1S/C28H30ClN5O4S/c1-17-25(30-18(2)26(17)28(36)34-12-10-32(3)11-13-34)16-23-22-15-21(8-9-24(22)31-27(23)35)39(37,38)33(4)20-7-5-6-19(29)14-20/h5-9,14-16,30H,10-13H2,1-4H3,(H,31,35)/b23-16-
InChIKey: FPYJSJDOHRDAMT-KQWNVCNZSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Penicillium chrysogenum | Penicillium | Aspergillaceae | Eurotiales | Eurotiomycetes | Ascomycota | Fungi | Eukaryota |
Properties Information
Molecule Weight: 568.0990000000002
TPSA？: 109.31
MolLogP？: 4.639840000000004
Number of H-Donors: 2
Number of H-Acceptors: 5
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Canis familiaris | Hepatocyte growth factor receptor | IC50 | 200.0 | nM | 10.1016/j.bmcl.2012.05.078 |
| Chlorocebus sabaeus | Vero C1008 | CC50 | 10420.0 | nM | 10.6019/CHEMBL4495565 |
| Homo sapiens | 3-phosphoinositide dependent protein kinase-1 | Thermal melting change | -0.6 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | AMP-activated protein kinase, alpha-2 subunit | Thermal melting change | 4.0 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | ATP-dependent DNA helicase Q1 | Potency | 28183.8 | nM | None |
| Homo sapiens | Beta-glucocerebrosidase | Potency | 22387.2 | nM | None |
| Homo sapiens | Bromodomain-containing protein 4 | Delta TM | -1.779 | C | None |
| Homo sapiens | BT-474 | Activity | nan | None | 10.1016/j.ejmech.2011.10.051 |
| Homo sapiens | BXPC-3 | IC50 | 16000.0 | nM | 10.1021/jm101340q |
| Homo sapiens | CaM kinase I delta | Thermal melting change | 0.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | CaM kinase I gamma | Thermal melting change | 1.7 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | CaM kinase II alpha | Thermal melting change | 3.0 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | CaM kinase II beta | Thermal melting change | 0.8 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | CaM kinase II delta | Thermal melting change | 0.5 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | CaM kinase II gamma | Thermal melting change | 0.6 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | CaM kinase IV | Thermal melting change | -0.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | CaM-kinase kinase beta | Thermal melting change | 1.2 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | cAMP-dependent protein kinase alpha-catalytic subunit | Thermal melting change | 3.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Casein kinase I delta | Delta TM | 2.175 | C | None |
| Homo sapiens | Casein kinase I gamma 1 | Thermal melting change | 0.6 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Casein kinase I gamma 2 | Thermal melting change | 0.3 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Casein kinase I isoform gamma-3 | Thermal melting change | 1.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | c-Jun N-terminal kinase, JNK | Activity | nan | None | 10.1073/pnas.0703205104 |
| Homo sapiens | Cyclin-dependent kinase 2 | Delta TM | -0.8495 | C | None |
| Homo sapiens | Cyclin-dependent kinase 2 | Thermal melting change | -0.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Cyclin-dependent kinase 2/cyclin E1 | Ki | 489.78 | nM | 10.1021/jm200979x |
| Homo sapiens | Cyclin-dependent kinase 6 | Thermal melting change | -0.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Cyclin-dependent kinase-like 1 | Thermal melting change | -0.5 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Death-associated protein kinase 3 | Thermal melting change | 2.6 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | DLD-1 | Activity | nan | None | 10.1073/pnas.0703205104 |
| Homo sapiens | DNA polymerase kappa | Potency | 21192.3 | nM | None |
| Homo sapiens | Dual specificity mitogen-activated protein kinase kinase 2 | Thermal melting change | 1.0 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Dual specificity mitogen-activated protein kinase kinase 6 | Thermal melting change | 3.0 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Dual specificity protein kinase CLK2 | Thermal melting change | 5.9 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Dual specificity protein kinase CLK3 | Thermal melting change | 3.7 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Dual specificty protein kinase CLK1 | Thermal melting change | 2.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Ephrin type-A receptor 2 | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Ephrin type-B receptor 2 | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Epidermal growth factor receptor erbB1 | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 101.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 106.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 107.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 108.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 110.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 125.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 43.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 64.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 65.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 68.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 70.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 71.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 72.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 76.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 79.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 82.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 88.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 90.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 99.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 108.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 139.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast growth factor receptor 1 | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Fibroblast growth factor receptor 3 | Delta TM | 1.182 | C | None |
| Homo sapiens | Glycogen synthase kinase-3 beta | Delta TM | -0.06165 | C | None |
| Homo sapiens | Glycogen synthase kinase-3 beta | Thermal melting change | 4.2 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 233.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 256.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 274.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 293.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 322.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 351.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 594.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 98.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 157.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 162.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 173.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 178.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 198.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 211.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 212.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 214.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 219.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 223.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 230.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 243.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 246.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 254.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 295.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 469.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Hepatocyte growth factor receptor | Activity | nan | None | 10.1073/pnas.0703205104 |
| Homo sapiens | Hepatocyte growth factor receptor | IC50 | 10.0 | nM | 10.1021/jm2007613 |
| Homo sapiens | Hepatocyte growth factor receptor | IC50 | 14.0 | nM | 10.1021/jm101340q |
| Homo sapiens | Hepatocyte growth factor receptor | IC50 | 20.0 | nM | 10.1016/j.ejmech.2011.05.031 |
| Homo sapiens | Hepatocyte growth factor receptor | IC50 | 20.0 | nM | 10.1073/pnas.0708800104 |
| Homo sapiens | Hepatocyte growth factor receptor | IC50 | 152.0 | nM | 10.1016/j.ejmech.2011.10.051 |
| Homo sapiens | Hepatocyte growth factor receptor | IC50 | 228.0 | nM | 10.1016/j.ejmech.2011.10.051 |
| Homo sapiens | Hepatocyte growth factor receptor | IC50 | 1561.0 | nM | 10.1016/j.ejmech.2011.10.051 |
| Homo sapiens | Hepatocyte growth factor receptor | Inhibition | 61.8 | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Hepatocyte growth factor receptor | Inhibition | 70.0 | % | 10.1016/j.bmc.2015.11.038 |
| Homo sapiens | Hepatocyte growth factor receptor | Inhibition | nan | % | 10.1016/j.bmc.2012.12.050 |
| Homo sapiens | Hepatocyte growth factor receptor | Inhibition | nan | % | 10.1016/j.bmc.2015.11.038 |
| Homo sapiens | HepG2 | Activity | nan | None | 10.1016/j.ejmech.2011.10.051 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -4.18 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -0.32 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Inactive serine/threonine-protein kinase VRK3 | Thermal melting change | nan | None | 10.1073/pnas.0708800104 |
| Homo sapiens | Insulin-like growth factor I receptor | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Macrophage-stimulating protein receptor | Inhibition | 52.2 | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | MAP kinase ERK1 | Thermal melting change | 0.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | MAP kinase ERK2 | Delta TM | -0.4178 | C | None |
| Homo sapiens | MAP kinase p38 alpha | Activity | nan | None | 10.1073/pnas.0703205104 |
| Homo sapiens | MAP kinase p38 beta | Thermal melting change | 0.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | MCF7 | Activity | nan | None | 10.1016/j.ejmech.2011.10.051 |
| Homo sapiens | MCF7 | IC50 | 6200.0 | nM | 10.1021/jm101340q |
| Homo sapiens | MDA-MB-231 | IC50 | 11000.0 | nM | 10.1021/jm101340q |
| Homo sapiens | Menin/Histone-lysine N-methyltransferase MLL | Potency | 15848.9 | nM | None |
| Homo sapiens | Mitogen-activated protein kinase 6 | Thermal melting change | 1.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Mitogen-activated protein kinase kinase kinase 5 | Thermal melting change | -0.7 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | MKN-45 | IC50 | 1300.0 | nM | 10.1021/jm101340q |
| Homo sapiens | Myotonin-protein kinase | Thermal melting change | 2.2 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | NCI-H1993 | IC50 | 7300.0 | nM | 10.1021/jm101340q |
| Homo sapiens | NCI-H441 | IC50 | 13000.0 | nM | 10.1021/jm101340q |
| Homo sapiens | PDZ-binding kinase | Thermal melting change | 0.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Peregrin | Delta TM | -1.151 | C | None |
| Homo sapiens | Platelet-derived growth factor receptor alpha | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Platelet-derived growth factor receptor beta | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Protein tyrosine kinase 2 beta | Ki | 10.47 | nM | 10.1021/jm200979x |
| Homo sapiens | Receptor protein-tyrosine kinase erbB-2 | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Ribosomal protein S6 kinase alpha 3 | Thermal melting change | 7.7 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Ribosomal protein S6 kinase alpha 3 | Thermal melting change | 11.3 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase 10 | Thermal melting change | 1.8 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase 16 | Thermal melting change | 0.6 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase 17A | Thermal melting change | 3.3 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase 2 | Thermal melting change | 2.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase 25 | Thermal melting change | nan | None | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase 38 | Thermal melting change | 4.2 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | Delta TM | 0.1975 | C | None |
| Homo sapiens | Serine/threonine-protein kinase Chk2 | Thermal melting change | 2.9 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase MST1 | Thermal melting change | 0.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase MST4 | Thermal melting change | -0.2 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase MST4 | Thermal melting change | 5.0 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase NEK2 | Thermal melting change | 0.1 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase NEK6 | Thermal melting change | 0.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase OSR1 | Thermal melting change | 1.6 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PAK 4 | Thermal melting change | 1.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PAK6 | Thermal melting change | 2.0 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PAK7 | Thermal melting change | 0.9 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PCTAIRE-1 | Thermal melting change | -0.6 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PIM1 | Thermal melting change | -0.2 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PIM2 | Thermal melting change | 1.0 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PIM3 | Thermal melting change | 9.7 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PLK1 | Thermal melting change | 1.9 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase PLK4 | Thermal melting change | 0.8 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase RIO2 | Thermal melting change | 1.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase VRK1 | Thermal melting change | 1.5 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Serine/threonine-protein kinase VRK2 | Thermal melting change | nan | None | 10.1073/pnas.0708800104 |
| Homo sapiens | SNU1 | IC50 | 7000.0 | nM | 10.1021/jm101340q |
| Homo sapiens | SNU-5 | IC50 | 800.0 | nM | 10.1021/jm101340q |
| Homo sapiens | Stem cell growth factor receptor | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | TRAF2- and NCK-interacting kinase | Thermal melting change | 0.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Transcription intermediary factor 1-alpha | Delta TM | -1.019 | C | None |
| Homo sapiens | Tyrosine-protein kinase ABL | Delta TM | 3.799 | C | None |
| Homo sapiens | Tyrosine-protein kinase JAK1 | Thermal melting change | 3.4 | degrees C | 10.1073/pnas.0708800104 |
| Homo sapiens | Tyrosine-protein kinase receptor RET | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Tyrosine-protein kinase SRC | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Tyrosine-protein kinase ZAP-70 | Ki | 10000.0 | nM | 10.1021/jm200979x |
| Homo sapiens | Tyrosyl-DNA phosphodiesterase 1 | Potency | 12589.3 | nM | None |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 43.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 102.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 152.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 153.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 165.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 212.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 330.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 58.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 59.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 62.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 63.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 65.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 70.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 71.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 84.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 90.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 140.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 144.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 147.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 186.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 261.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 271.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 272.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 305.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Vascular endothelial growth factor receptor 1 | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Homo sapiens | Vascular endothelial growth factor receptor 2 | Inhibition | nan | % | 10.1016/j.bmcl.2011.11.003 |
| Mus musculus | BaF3 | IC50 | 530.0 | nM | 10.1021/jm101340q |
| Mus musculus | BaF3 | IC50 | 6400.0 | nM | 10.1021/jm101340q |
| Mus musculus | NIH3T3 | IC50 | 2000.0 | nM | 10.1021/jm101340q |
| Mus musculus | NIH3T3 | IC50 | 50000.0 | nM | 10.1021/jm101340q |
| Mus musculus | Nuclear receptor ROR-gamma | Potency | 19952.6 | nM | None |
| Mus musculus | Nuclear receptor ROR-gamma | Potency | 35481.3 | nM | None |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 228.0 | nM | 10.1016/j.bmcl.2009.07.095 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 317.0 | nM | 10.1016/j.bmcl.2009.07.095 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 320.0 | nM | 10.1016/j.bmcl.2009.07.095 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 620.0 | nM | 10.1016/j.bmcl.2009.07.095 |
| Plasmodium falciparum | Plasmodium falciparum | Inhibition | 85.07 | % | 10.1016/j.bmcl.2009.07.095 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 4.722 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 10870.0 | nM | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | -0.18 | % | 10.21203/rs.3.rs-23951/v1 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 1.22 | % | 10.6019/CHEMBL4495565 |
| None | ADMET | Selectivity index | 0.96 | None | 10.6019/CHEMBL4495565 |
| None | NON-PROTEIN TARGET | Activity | nan | None | 10.1016/j.ejmech.2011.10.051 |
| None | Unchecked | Activity | nan | None | 10.1073/pnas.0703205104 |
| None | Unchecked | Potency | 10000.0 | nM | None |
| None | Unchecked | Potency | 11220.2 | nM | None |
| None | Unchecked | Selectivity ratio | 60.0 | None | 10.1073/pnas.0708800104 |
| None | Unchecked | Selectivity ratio | 400.0 | None | 10.1073/pnas.0708800104 |