Rufomycin NBZ3
AlkaPlorer ID: AK324449
Synonym: None
IUPAC Name: (3S,6S,9S,12S,15S,18S,21S)-15-[(E)-but-2-enyl]-21-[(2S)-3-hydroxy-2-methylpropyl]-6-[(4-hydroxy-3-nitrophenyl)methyl]-1,3,10-trimethyl-12-[[1-(2-methylbut-3-en-2-yl)indol-3-yl]methyl]-9,18-bis(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone
Structure
SMILES: C=CC(C)(C)N1C=C(C[C@@H]2NC(=O)[C@H](C/C=C/C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C[C@H](C)CO)N(C)C(=O)[C@H](C)NC(=O)[C@H](CC3=CC=C(O)C([N+](=O)[O-])=C3)NC(=O)[C@H](CC(C)C)N(C)C2=O)C2=CC=CC=C21
InChI: InChI=1S/C54H77N9O11/c1-13-15-19-38-47(66)59-41(28-36-29-62(54(9,10)14-2)42-20-17-16-18-37(36)42)53(72)61(12)44(24-32(5)6)50(69)58-40(26-35-21-22-46(65)43(27-35)63(73)74)48(67)55-34(8)52(71)60(11)45(25-33(7)30-64)51(70)57-39(23-31(3)4)49(68)56-38/h13-18,20-22,27,29,31-34,38-41,44-45,64-65H,2,19,23-26,28,30H2,1,3-12H3,(H,55,67)(H,56,68)(H,57,70)(H,58,69)(H,59,66)/b15-13+/t33-,34-,38-,39-,40-,41-,44-,45-/m0/s1
InChIKey: UICGAVRXXGVGKH-ZAQFJHMCSA-N
Reference
Antimycobacterial Rufomycin Analogues from <i>Streptomyces atratus</i> Strain MJM3502
PubChem CID: 156022159
NPASS: NPC487529
{NPAtlas: NPA029607
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Streptomyces atratus | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 1028.262
TPSA？: 274.6499999999999
MolLogP？: 4.149800000000011
Number of H-Donors: 7
Number of H-Acceptors: 12
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Chlorocebus sabaeus | Vero | IC50 | 100000.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | ATP-dependent Clp protease ATP-binding subunit ClpC1 | Kd | 1100.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MBC | 9.6 | uM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MBC | 10.0 | uM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 840.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 4000.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacteroides abscessus | Mycobacteroides abscessus | MIC | 9300.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| None | Unchecked | Selectivity Index | 119.0 | None | 10.1021/acs.jnatprod.9b01095 |