Rufomycin NBZ6
AlkaPlorer ID: AK324452
Synonym: None
IUPAC Name: (3S,6S,9S,12S,15S,18S,21S)-15-[(E)-but-2-enyl]-6-[(4-hydroxy-3-nitrophenyl)methyl]-1,3-dimethyl-9,18,21-tris(2-methylpropyl)-12-[[1-[2-[(2S)-oxiran-2-yl]propan-2-yl]indol-3-yl]methyl]-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone
Structure
SMILES: C/C=C/C[C@@H]1NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C)NC(=O)[C@H](CC2=CC=C(O)C([N+](=O)[O-])=C2)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC2=CN(C(C)(C)[C@H]3CO3)C3=CC=CC=C23)NC1=O
InChI: InChI=1S/C53H75N9O11/c1-12-13-17-36-46(64)58-40(26-34-27-61(53(9,10)45-28-73-45)41-18-15-14-16-35(34)41)50(68)56-37(21-29(2)3)49(67)57-39(24-33-19-20-44(63)42(25-33)62(71)72)47(65)54-32(8)52(70)60(11)43(23-31(6)7)51(69)59-38(22-30(4)5)48(66)55-36/h12-16,18-20,25,27,29-32,36-40,43,45,63H,17,21-24,26,28H2,1-11H3,(H,54,65)(H,55,66)(H,56,68)(H,57,67)(H,58,64)(H,59,69)/b13-12+/t32-,36-,37-,38-,39-,40-,43-,45+/m0/s1
InChIKey: RMGQPCJBCAGCTM-RKLCLHEHSA-N
Reference
Antimycobacterial Rufomycin Analogues from <i>Streptomyces atratus</i> Strain MJM3502
PubChem CID: 156011215
NPASS: NPC487532
{NPAtlas: NPA029612
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Streptomyces atratus | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 1014.2349999999998
TPSA?: 275.74
MolLogP?: 4.048000000000009
Number of H-Donors: 7
Number of H-Acceptors: 12
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Chlorocebus sabaeus | Vero | IC50 | 100000.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | ATP-dependent Clp protease ATP-binding subunit ClpC1 | Kd | 1500.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | ATP-dependent Clp protease ATP-binding subunit ClpC1 | Kd | nan | None | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MBC | 2.2 | uM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MBC | 10.0 | uM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 570.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 4000.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| Mycobacteroides abscessus | Mycobacteroides abscessus | MIC | 10000.0 | nM | 10.1021/acs.jnatprod.9b01095 |
| None | Unchecked | Selectivity Index | 175.0 | None | 10.1021/acs.jnatprod.9b01095 |
