None
AlkaPlorer ID: AK324468
Synonym: None
IUPAC Name: (1S,2R,4S,5R,8S,9E,11Z,13E,15S,22S,23R,24R)-2,4-dihydroxy-9,15-dimethyl-25-oxa-17-azatetracyclo[20.2.1.05,24.08,23]pentacosa-6,9,11,13-tetraene-18,20-dione
Structure
SMILES: C/C1=C\C=C/C=C/[C@H](C)CN=C(O)CC(=O)C[C@@H]2O[C@H]3[C@@H]4[C@@H](C=C[C@H]1[C@H]42)[C@@H](O)C[C@H]3O
InChI: InChI=1S/C25H33NO5/c1-14-6-4-3-5-7-15(2)17-8-9-18-19(28)12-20(29)25-24(18)23(17)21(31-25)10-16(27)11-22(30)26-13-14/h3-9,14,17-21,23-25,28-29H,10-13H2,1-2H3,(H,26,30)/b5-3-,6-4+,15-7+/t14-,17+,18-,19-,20+,21-,23-,24+,25+/m0/s1
InChIKey: QPYKFWDFFXJDAQ-VZQDBODISA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 427.54100000000005
TPSA？: 99.35
MolLogP？: 2.928100000000002
Number of H-Donors: 3
Number of H-Acceptors: 5
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus fumigatus | Aspergillus fumigatus | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |
| Candida albicans | Candida albicans | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |
| Escherichia coli | Escherichia coli | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |
| Homo sapiens | HeLa | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |
| Homo sapiens | HL-60 | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 12000.0 | nM | 10.1021/acs.jnatprod.0c00755 |
| Pyricularia oryzae | Pyricularia oryzae | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |
| Rattus norvegicus | NRK | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |
| Staphylococcus aureus | Staphylococcus aureus | Activity | nan | None | 10.1021/acs.jnatprod.0c00755 |