(1E)-N-Hydroxy-2-{5-[(1E)-3-methylbuta-1,3-dien-1-yl]-1H- indol-3-yl}ethanimine
AlkaPlorer ID: AK324584
Synonym: None
IUPAC Name: (NE)-N-[2-[5-[(1E)-3-methylbuta-1,3-dienyl]-1H-indol-3-yl]ethylidene]hydroxylamine
Structure
SMILES: C=C(C)/C=C/C1=CC=C2NC=C(C/C=N\O)C2=C1
InChI: InChI=1S/C15H16N2O/c1-11(2)3-4-12-5-6-15-14(9-12)13(10-16-15)7-8-17-18/h3-6,8-10,16,18H,1,7H2,2H3/b4-3+,17-8-
InChIKey: AXIGXWXFKXWZDN-LRZMSQBSSA-N
Reference
Indothiazinone, an Indolyl Thiazolyl Ketone from a Novel Myxobacterium Belonging to the Sorangiineae
PubChem CID: 86302583
LOTUS: LTS0269718
NPASS: NPC488004
{NPAtlas: NPA017957
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | None | None | Myxococcales | Myxococcia | Myxococcota | None | Bacteria |
Properties Information
Molecule Weight: 240.306
TPSA?: 48.38
MolLogP?: 3.759700000000002
Number of H-Donors: 2
Number of H-Acceptors: 2
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Amorphotheca resinae | Amorphotheca resinae | Inhibition | nan | % | 10.1021/np500144t |
| Aspergillus clavatus | Aspergillus clavatus | MIC | 67.0 | ug.mL-1 | 10.1021/np500144t |
| Candida albicans | Candida albicans | Inhibition | nan | % | 10.1021/np500144t |
| Chromobacterium violaceum | Chromobacterium violaceum | Inhibition | nan | % | 10.1021/np500144t |
| Debaryomyces hansenii | Debaryomyces hansenii | MIC | 67.0 | ug.mL-1 | 10.1021/np500144t |
| Eremothecium coryli | Eremothecium coryli | Inhibition | nan | % | 10.1021/np500144t |
| Escherichia coli | Escherichia coli | Inhibition | nan | % | 10.1021/np500144t |
| Micrococcus luteus | Micrococcus luteus | Inhibition | nan | % | 10.1021/np500144t |
| Mucor hiemalis | Mucor hiemalis | MIC | 67.0 | ug.mL-1 | 10.1021/np500144t |
| Mus musculus | L929 | LC50 | 6.8 | ug.mL-1 | 10.1021/np500144t |
| Mycolicibacterium diernhoferi | Mycolicibacterium diernhoferi | Inhibition | nan | % | 10.1021/np500144t |
| Nocardia sp. | Nocardia sp. | MIC | 33.3 | ug.mL-1 | 10.1021/np500144t |
| Paenibacillus polymyxa | Paenibacillus polymyxa | Inhibition | nan | % | 10.1021/np500144t |
| Pichia membranifaciens | Pichia membranifaciens | Inhibition | nan | % | 10.1021/np500144t |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | nan | % | 10.1021/np500144t |
| Rhodotorula glutinis | Rhodotorula glutinis | MIC | 67.0 | ug.mL-1 | 10.1021/np500144t |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | Inhibition | nan | % | 10.1021/np500144t |
| Schizosaccharomyces pombe | Schizosaccharomyces pombe | MIC | 67.0 | ug.mL-1 | 10.1021/np500144t |
| Staphylococcus aureus | Staphylococcus aureus | Inhibition | nan | % | 10.1021/np500144t |
| Wickerhamomyces anomalus | Wickerhamomyces anomalus | Inhibition | nan | % | 10.1021/np500144t |
| None | NON-PROTEIN TARGET | Inhibition | nan | % | 10.1021/np500144t |
| None | NON-PROTEIN TARGET | MIC | 33.3 | ug.mL-1 | 10.1021/np500144t |
| None | NON-PROTEIN TARGET | MIC | 67.0 | ug.mL-1 | 10.1021/np500144t |
