Thaxtomin C
AlkaPlorer ID: AK325977
Synonym: None
IUPAC Name: (3S,6S)-3-benzyl-1-methyl-6-[(4-nitro-1H-indol-3-yl)methyl]piperazine-2,5-dione
Structure
SMILES: CN1C(=O)[C@H](CC2=CC=CC=C2)N=C(O)[C@@H]1CC1=CNC2=CC=CC([N+](=O)[O-])=C12
InChI: InChI=1S/C21H20N4O4/c1-24-18(11-14-12-22-15-8-5-9-17(19(14)15)25(28)29)20(26)23-16(21(24)27)10-13-6-3-2-4-7-13/h2-9,12,16,18,22H,10-11H2,1H3,(H,23,26)/t16-,18-/m0/s1
InChIKey: IAIWBAHUWORDTI-WMZOPIPTSA-N
Source
Properties Information
Molecule Weight: 392.4150000000001
TPSA?: 111.83
MolLogP?: 3.027000000000001
Number of H-Donors: 2
Number of H-Acceptors: 4
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Abutilon theophrasti | Abutilon theophrasti | Activity | 0.0 | % | 10.1021/jf0012998 |
| Abutilon theophrasti | Abutilon theophrasti | Activity | 50.0 | % | 10.1021/jf0012998 |
| Agrostis stolonifera var. palustris | Agrostis stolonifera var. palustris | Activity | nan | None | 10.1021/jf0012998 |
| Agrostis stolonifera var. palustris | Agrostis stolonifera var. palustris | I50 | 40.0 | ppb | 10.1021/jf0012998 |
| Arabidopsis thaliana | Arabidopsis thaliana | GI | nan | None | 10.1021/jf0012998 |
| Arabidopsis thaliana | Arabidopsis thaliana | I50 | 50.0 | ppb | 10.1021/jf0012998 |
| Avena fatua | Avena fatua | Activity | 0.0 | % | 10.1021/jf0012998 |
| Echinochloa crus-galli | Echinochloa crus-galli | Activity | 0.0 | % | 10.1021/jf0012998 |
| Echinochloa crus-galli | Echinochloa crus-galli | Activity | 20.0 | % | 10.1021/jf0012998 |
| Echinochloa crus-galli | Echinochloa crus-galli | Activity | 40.0 | % | 10.1021/jf0012998 |
| Helianthus annuus | Helianthus annuus | Activity | 0.0 | % | 10.1021/jf0012998 |
| Helianthus annuus | Helianthus annuus | Activity | 30.0 | % | 10.1021/jf0012998 |
| Helianthus annuus | Helianthus annuus | Activity | 70.0 | % | 10.1021/jf0012998 |
| Helianthus annuus | Helianthus annuus | Activity | 75.0 | % | 10.1021/jf0012998 |
| Ipomoea hederacea | Ipomoea hederacea | Activity | 70.0 | % | 10.1021/jf0012998 |
| Ipomoea hederacea | Ipomoea hederacea | Activity | 80.0 | % | 10.1021/jf0012998 |
| Ipomoea hederacea | Ipomoea hederacea | Activity | nan | None | 10.1021/jf0012998 |
| Ipomoea hederacea | Ipomoea hederacea | GR50 | 125.0 | g/ha | 10.1021/jf0012998 |
