Ayamycin
AlkaPlorer ID: AK326289
Synonym: None
IUPAC Name: (4S,5S)-1,1-dichloro-4-ethyl-5-(4-nitrophenyl)hexan-2-one
Structure
SMILES: CC[C@@H](CC(=O)C(Cl)Cl)[C@H](C)C1=CC=C([N+](=O)[O-])C=C1
InChI: InChI=1S/C14H17Cl2NO3/c1-3-10(8-13(18)14(15)16)9(2)11-4-6-12(7-5-11)17(19)20/h4-7,9-10,14H,3,8H2,1-2H3/t9-,10-/m0/s1
InChIKey: YJUBDQRBJQTJHH-UWVGGRQHSA-N
Reference
Novel Bioactive Metabolites from a Marine Derived Bacterium Nocardia sp. ALAA 2000
PubChem CID: 24938846
LOTUS: LTS0242895
{NPAtlas: NPA018409
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Nocardia sp. | Nocardia | Nocardiaceae | Mycobacteriales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 318.20000000000005
TPSA？: 60.21
MolLogP？: 4.487400000000004
Number of H-Donors: 0
Number of H-Acceptors: 3
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus niger | Aspergillus niger | MIC | 0.1 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |
| Botrytis fabae | Botrytis fabae | MIC | 0.1 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |
| Candida albicans | Candida albicans | MIC | 0.1 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |
| Cryptococcus neoformans | Cryptococcus neoformans | MIC | 0.1 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |
| Ogataea angusta | Ogataea angusta | MIC | 0.1 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |
| Rhagastis acuta | Rhagastis acuta | MIC | 0.1 | ug.mL-1 | 10.1016/j.ejmech.2016.11.022 |